8L2C)pJJJJ IH(ȱH:=IH[H`@HcH  $ +   I/H`JLNGȄBȄF aK  haaFF  mJm# KKJ UJ )J ۈ) ;J3ȱJFȱJGJKaȄM  aaNNJFLGJL LL !Cb" %n"o" (#M8( % ) L'"p"q" (\4, )7(P0  ( @p 8  x"!b"i"0 ~&i"0 %r"s" (,) &Սt"u" ( %L'")0I0hx H( +00$WS19R00$WS2000$WS1700$WS1100$WS1200$WS13500$WS1400$WS1500WS16%00$WS18%00WS4U00#WS500#WS600#WS7<00#WS8t00STUDENTS.DAT55#WS2t00STUDENTS.DATk'REPORTS '9INPUT.ANYTHINGK1 E #WS900$WS1000$WS1600,WRKSHEET.DIRb 0#WS4gO00NS.DATj#WS3u'STARTUPwC'0(WRKSHEET{ 2 " 9RRKSHEET'' &PRODOS }<' /COMPILER.SYSTEM(#C'1()TITLE.PICK ' $ TITLE.TXT[i00COMPED.CS\00#WS1^? &PRODOS `DaElH$?EGvѶK+`L HHLy XP LM ŠϠĠӠS)*+,+`F)) (*=GJFjJJA QE'+ '== `@ STSP8QSS8 m P o R(8R %Щ ߩx"L! )L! 8'  )ɀ)4,- U JNT) x"Lv"w" ( !` a"M)Fi/ e"3 k"  !"#$%&آ <B*IBGF08Lé'+8H <,``h(`@ڍL3<>=?<>CAB@?A` 1 L  <>`ڢF]PL8i m L   6< L  BLRAM' hLDLHB-9F 3"aɿ LLB Nϰ H  @h( L Lj  @`eLJCAB@=?.<ʆ>,=?BC8 é&'112``* G** c*` v* G* c*`hh8`8`***`}*`e`H)hJJ*0JJ)` (< ( < *? ( < (? ( < (? ( <*? * **? *? *? ( < *? ( <ȱȱȱȱ0]cȱeem*ȱ*ȱ**ȱ**ȱ* )* * )L(`L?* *Ll) ) L( )Ll)8e` ,$`ee` < @( )m((.(( M(i ``) |'(j21 z& {&!` ({&z&(i({&(( CBDFGE (r&$ 3(,}&r& … 3(ŅL&JJJJ`Ϡ'8`r&h)hr')L&18|&"m11 2H22h2舌|&|&12H)M0 h10200I20h2 (`LE%12 `_'"L  <8# ȱ)ɀ  )( ` (Xp0`ŠӠֱҭԠŠҬî̠ӠĮʎ1|&… (n}&Dž (\%Tz&Lc()8= (J 8'z&'{& 3((ʎ1|&|&|&3223 `%YYZLYLYLY뿭` 8!@8` %MNЩUMߩ  L 5   8 0 8  `0 / X& & +&&7&P^& S ɘL   V7 L ' 0% '8 Jm ʈ0  0ŠϠĠ͢Š͠͠ϠŠŠϠĠخ͠ ͍B B(8. ) ɘ"    L=#=#&ŠϠĠԠŠ ԩ m# m# J Qڨ)̰m] нȱ ̀𩠙 i F >l"m" h" iL X%;"L8"ΠΠҠ`y""""""*$ Fk%YeQP!/RB}QBiBB}\ ĉFEL/#> ț6 hh@ihAiH(ؠȱ@JJJJq@)@Yvȱ@Hȱ@Ah@y@cYe J) LL LJiB LJ) >xhHHHHL(  ްƠx@BEOD  ް(`( C)CJJJlB O-`J,~@~@}J@` ߩ%S @ ~`E hhhߺ0 h ߐ( ߐ ߐ ߐ  0 HϭߍLпllllIL/FHGI ҭJjHIHB>IؙJJ W: ELyHIHI`JKJK`FHIG ( Ȣ؝؈JL)eKM`)` J zJ͟ $0 ΎJFJL8`JGBJ P ؑ@`M8`8@ؐʈI묆)z8zz Ly LةC8`؍)@ i)z8zyJ ^ ؅F Lo) +%J(a *FإGؐ.` *JHIH ۩ ٰz{`JJJJ;i v묅͚ vٍ0  `H8` `ٍyٍiB0H0FG h0`FG `ϩBxED0C ް(`(8`{ `ٽJJJJ`H͐hn)NjNjNjN. CH͐ v;٭ *Nۙ۰ڙک `Z8` C# (`{ .{ .{ .{8۰*Jzܝ٭(ܝ`)َ 8ʈ` 0ٝ)i `8`R ꍐz{ vNمFمG < ΐ0 FGL鮅0 ٭{٭zٽ8`H8`  ,z { 8` z E8`1ݾ00 Y 0ʩ 谼 谷`12)1`0`Ȏi 0U`)8`ά` W xG 0A)H ܝʈh٭0٭)ܝ٭*ܝ٥F٥G٭'ȱHά`Ύ8EeHI |SB:0M ٙKٙIFNGʈ d献`8m0`,0H hi PȽάhٍ0GF8yאFG  $0 G01܅I `P܍QR d8D`F` ]lH)HFȍNHGO $%܍&܍!ܢ8* J8` L ܝ>)I 'ܝ:`F8iRFPGQ`F܅IH3H ( )O 밨G%܈D" T)Ii)܍R*܍E'ܮ( 4 䭐 $H %HFFHGHG 됬`R8`)` EHS` #Q'܅IHHSSЍS@`8 ` ͍% ΍Q8`ʈ@qȱ@cȱ@mopfNxOyS)5SI0ܢܽ iP'E* 7deFG (GH Lv܅IR mEIH` tq qM0PQ ESHNFOG 밳NN` G8`F@ 0 > LK8`: ;I8`FHGH hGhF܌ բFܽܕF芝ܝ 밶:; <܅I m=IHHyHȘI Lܝ` @c@ k@Ю׍S)mיSi 뎅`C8` @ r3N@) G莱 ⭮i`0 Y; 뮅ٝ٘ 0 W,0 .H hȑNWȮّNW8`ٍّNά0N뎒׮Б` L` @>S)I38Mdeם`K8`@Nȱ@O@ rIiNȽבN)/ȩ/N`@[ WHJjjjhA ,'KI؍0JHhh8` Qx")T'P) ɺiL; )?     ~ `l@Hȱ@IױHXATȱH ɯȩ׍̒5H)/@a)_ .0 :A[8@`,FإG`BH PFإG`,H hHB؅F  ؅GxDE؍00C ް(`(8` vL'J  6"L vH  6 9ؙ` @ P8`K8`B8` L؈SJJJJحq) ) )Ю ЪGdF $ ᭔ع+ؠ 2H  :h8` 䮅ٽ ٬ؠ@` ( L )8`)i п` H h)N$%hꭋILhH),Nx8 (8` ԍ`@ABe 2U,,CnZ1IJK,-NOPQRSuHUSTON!' @  K cXXK تKo`V8`no` , on cI9XX`)HJJJh`OeNeO࿰ c9XАO`@ȭ@` ON INJKO`Hх 밽܅F݅G ` c* Z% L`L뮴HH hFhG܍ݍ 8 `FHGH  hGhF`ݹܙ݊`@Bɼ>K@J5 c9X(N    ܮ `J HH hh` 0 @ L/L Z`̸Yܝ ݝ0̸ȩFG   0` ܅F݅G ` c Zͬ LȹL@ȅH@IL,0` G וֹ= YH.q)N 0 >deS)@LP8` D᮴ ֩SGHG v L䬅yٙ٭yٙ٩`K CEdFeG 6%&ȹP8` i` %ם0 B %)( ȹ`8m8m@8` G8`F Pq)@N8`S)@J טyרםSS)׍Sde 밑 Ȣ؝I؈ 2h(8H ( h(8Hh(`ؑ@`@ȱ@ ` B@8ZS d鮅ٍٍٍsHٍr8fhgSJJJJS)S@` %I -q) 0@S)N8` @LL =@ ؝~@~ݞ@ʈL2 KIJHȢݞ)Jn 8 θ ؍ ؍ DH8 ع)ꭵJJJJ )߹0 )p )@ ) ȩ ؝L0NO 방 PQNOFG 嬆؍f؍g؝h ؝c zS) zS )حM͚ v`H@h`h``N8`  ) 1⬆iع `  عiعi` )؍0CGHFHBFG ުhFhG`@4͔ L @Ai ׭2` . :#ع؍0 Y讅)`.@+ i 8` L ؊ PLE΢ʱNLMOMEKP%MEK΢L$ O, PeNNO 2(` C  7 2JzHI{HI؊ }LE  *` A Hz ع H{ ؙ؊ؠIhHIhH } `؝}zIzؐ` f~ؽ؝z f % f؝~z؈` ` H  Ph)N@ 1; L  2$ )bJ Y ) H 4hL )  )حJjI{HIzHNO 8 ؍JL`R΢ʱLN1MOMEKP/MEK΢L7L-M O,p莡eNNO(`JNKOL 2/ "P L8 y WؑJ`L@ȱ@ `@Nȱ@O LL L r L 2 "pJ덣 )@፦NJOK 2iKK΢΢ IJΣ JФ̭JjHFIH HIGxKE ް((H hH h8`8@ȭ@L2쬆8N !"#$Ԡ͠ˠĠԠҠ(c)1983-1987 AppleLKL`BLL ެެެެެެެެެެެެެެެ(C)APPLE'83xLLM Mh@8nЍLޭ 0J @,,LNLG ASTARTUP$#   / XXύX?klmnÍoL) "6L'?"(0`6708" = ***)<0h)ύh0HHHH " ׍hhhhhhh .hh8`JIMJAYKERRY&MIKEFby LҠؠӠ΢ϠԩҠŠƠԠԠŠӢɯϠҠůȠԠĠ  ɈL :Lɍ)ې)ɮ۰ɺH h 'L  ġLL ̹L)'L ȳL O'F ʻ ̹(((L $ʩ $$ $L `ީ % K@D E  / XʩXύX X %   % ɍRH hɛɘɉɈ $ Ld :Ldې)ɮ۰ɺ' Ld  : X ( % ɛ$ɘɉ 8V%֌&8V֌֠)HV)hH)hHIhդD?DRIDQD)҅; ?JDQD]ՎՎՎ`MY pӭY)p  ӭp`C)`BFGV 8``8LխӅ:HhHh Ո թ թ ՘VYҪҦ>:Y)Ң`;R?AJ;<ȰY)Ң`Y?)Ң`ȐҰ ;HhHh=Ң`Hh `Hh`DEiȍ0֌1֍ZԍsԍԍԍԥDEԌ8TԌ8WpԌqԠ 7I꽌ɪ꽌ɭ蠪:љVE:8`]ѾV]H)]ѾV]ҙ)]ѾT]ҙ)] >8hUD` ԝY`> Hh݌(`HCJJJJ)*h`0($ p,&"op8`kkV꽌ɪɖxlӽ*kӽ-kәmMlӈ 꽌ɪ`8` *L o % ԽYӍZӭoӝY 3Ѡ шNZ`rZLkӭZӍq8r7IZӐiZkӐk 8 ѹs ӭq ѹ| kн Z)*>>` @ $(,048<@DHLPTX\`dh 0ުlptx| ֽ ְ& .Vӈ  JJJJH 8h Ei 8EX`'8`jӍWӥC)p> pӥCYӍY 轊( ( ӈBV ( ӭp0 \BkJ ՠ@iӦ> Ӑi'j:ZH i@ioZZH h ѐȭnWǥBJ Ӱ8XӦ>` Ր+>P׽8H  ): e: y8鰕:Jjjj<)yאi8i;i(*=>hPם8`;Zx3QZYXXWV[HEVhEhH)IWHPHHHAHHHLaVEWLӿJJH !h穖tp% ;"Z/݀>">"' 1" 7"5).莀/ ;" " 6" >" 1"6"$ "g"" !"""""Iz HL')*+,-./0123456789:;<=>?@ABCDEFGHIj>>m>` _m8injkiljo풼i>?Ek?>Q>> L> \/ e>>?́?ޱ>ȥpnG @p;G=po:Q>>>̀ `` \> ̀ `e>>?́?>?Emn(>e>ȱ>e?>Q>ؠ> ie>>?`|;}=:<~:<=;`||m};>:8o>oȑ>ppȑ>> :op`G DKJپھ pHJh` D!hgt}~p `~t}p8n~ni}tpi~~tso8pinii>j?k̈́>~|p|Ii||̈́ l - `>i>L8933LΞAAJL ةޘг uv $ 8LƞaЌ>?@`>?@`B8` K  춼LK ҟ ҟ ( KK`HJJJJ8`HK)` #hhL𚾤3 @LtJ)s@J b  l`a?sa?,E30ɍФ3 E3HD F3 Ʉ%h3 bM E  lLthɍLL3`3,A0s0% Ipn DpnI:L ؅303پھ p H־Ǿh۰8L־Jjjjɾ)Ⱦ8 ѱ OLӜ ĤLLX>(F`־ؾپھ׾` bɄ KDEF vLl v lL bKɍKL?` w  vLl@$݅3`(l8L3LX>(Ƀ,`3,G0]ɾ g` H`پ_پ p _پ׾`>( p۾m׾) W)ʩ@`ɾ>(O puȾ ɾ-O ]c־Jjjj `O>0O l PODEF޾ p ޾ p($ذ v (0 ( L?ԦʚLeةީa s  lL b,FLg,DL,C0$3 >@ Ɉ 3ɾꩈL(3ɾ;Ƀ B94 l% bʽ  ՚,S` H EH06172839h` v97L75v^a ?/( va?LLLɍ$?`?a ɍɥAH93827160hH46576879h`,C bL ɍ b w,S0 @ lLޭBYL 8!9 詍` "  à4"/pŠϠŠà͠ӠàԠŬh,PIN'ҍIxy /L6Ix y JpnoF /= plm /w)!,ZJYH)h****)  md8幙`\H[< h  /( 载쳼󩭙L/id /`H) hJJJJ ɺi` M  ` ת.8 `O`S  AI-L9 ᪰B C VWS`޾Lp h־Ҿ,G0^W)TP) ecfdپھ׾ؾӾ p$c d pccddީ 8`ȾɾʾNfne}ȾȾI>Ie f`8` P־ǾҾ,G0C f=W)_``\"׾پӾؾھ pD`־ǾY׾ؾOW)ݩȾɾʾ pD`8`W)CB) 5W) =)W)@! pZ}ȾȾ󰹩 p` ־ǾҾ,G 8`׾ؾ f p vۥs׾tؾE` 67إE` Ln  ` ` ފ `    8` HIihIi` 8` 0`F8` 8ompn` DLȱH z|h L湠H hHHzH|HH L|Ў   ۄ L   Ў   ۄ iL UHH d$ dhh d E0  d` c뤄 L Ў   ۄ L chh L ` ) #L ح 6 7ɐ ⌰8` `؍ 6 7 ۄ L MHH 3湠hh PI Ⱦ`Pp chh  Ў SLT Ў   鎥 % 湠8q` #HH hehep%` chh L Ў   ۄ L(8 8` HH 8h優hp` L |~e~eLׁ8t `Ln湠` 湱` 8`ɐ 릡`  M`Ll 0 `,`0  Lۄ L AL L L L :L L   Ў   L W XYgh ``   "gͪȱgͫȭgg yΣ` 8` gͪ ȱgͫ` 8`s8@I5gN Oz @n[Dz @nd0,~z @`$仫@v$⩔,C[B?I>孓`仫6VtCicQĿUKqtVt Nֵ#ح#׮2}q :IC@@ -!S    !C- !ABELSDFRV@@ !$(19@EüϠž(+@ABCDEFGHIKLMNPSsƬƀ#(ZZV4G_0=( A P FjL\5p-e9ABSAVERIFYBLOADELETEBYECATALOGOPENWRITEXECREATEFRESTORENAMEBRUNLOCKCHAIN#FLUSHREADPOSITIONOMONPR#PREFIXCLOSEAPPEND6D(!쫂8 ( 8о(־Ǿ,G 8`_`W)H־Jjjjh p̭ fLᶢǾ ת..8 ۭ (8mȾȾmɾɾʾiʾ` Lpl8l:/,s̑~z hh|hzhh` \ eL \ L \ [LLl$` \ L \ L3 TL  \ ` v \`H 4h`$ d  0$-`&&8 ` \3 JL \ 2優L3 20 L@i)${L L XL sL wL L L$, ,{(` W80 `L3 )3`  +E:L0 $L  Z Z ,բ 򇅄":,ʅʆȽ Ņń"莤&& ee`湠 Lx) H HLGHH ˌhhHH餍0mzn|hhȥȥȥȌ1 !10Ƥx)P 锐 Ll&m1ȥiHemmhenWnpoHH hhphhhȊȥL ML +LkLn湠8 ┥HH ˌhhHHz|┠hhѕ Dѕ9ȱȱȌ eeкx)P LԔkLn&q~q`xLn8mLL ILؒ  HHH \hhhʊIńLl ȱ` HH hhq36 ؑei`LnL 'x) ȱȱ`L? 'x)HHH nߑ`LȆ8L \H ؑhȑ` ` HH hhї ȱї ї,q`   ؑL vȹ ؑȑ` HH \hh`  hhHH` @#HH 0 J ChhL0:)`3 aL"ȱ)389ȱ \Ą8pn ` WL ؑL` 8e`*Lnߑooppmh` WL :L  MHH \ hh`Ll膄醅ф eȱe`Ll L u L u q` \(  \0`Ll \ \L\ 0(؆, L (ɨ0- (Lstopijklmn S 5hL⎥$ && ee兊` &e`湬Fl \,S,TL慅 ,W,P`@ \,U,RL \L \L \ dL \ LLl \ Lʏ \ 1 L \ Lߏ \ 1 aLH MLn   L \ `8 ˌ./ \3( \1-I)L ˌFG \EL L ˌqr(  Ls pL ˌ` ˌmnsotpL ˌstijLijL/ Le`u` rhhHHH`hh== 8``?LH \h`B B` @`Hegheh` y橊 o АL Cghgg $L gȱg uxy Oxyvw Ovw xu Ǝij`|~`湠z|~`z|~L? АLuz|~`L SLvw`Ln$085$0, Z $L`H \h $ AL򊮟Llɐ 릡` ɐД0榟`)1 o35 K 0 کL \ ieiȱ e$ HHLlL` А vLlئL8pn LlL湠  Ll湠  ~|zL L r륝z %  Lu LLrHzm|hm~pݬ  pP L PI  l,0L\,0 [L ʊ ۄ  ~|zL% ⋭  +  ,0,0  +L `0 +L܈( [L uȌ`ܬ8ȹL `~`L  [L( (`Ln湠 8 L٥ ` :`3 a ,թ,LɃLLn3 ZL LiHiHegȱehLLhh%L  [LhhLLnL   +뤸L 5TFaeJ[Ǐ܏ӏh 9QNvٓK$02 ./y˃$؂CG/ Ғ zxRk_ZjƂςF.\?REENTERLL\LԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժժՊԪՂժЪՀժԂԂԂԂժЪՀժԂԂԂԂժժՂժՊЪЊՀժՂժԂԪժՀՀՀՀՊЪՀՂԂժՂԪժԪժժժժՊժՊժՀժժՂժՊЪՀЊՀЊԂՊЪՀժЪԪժՀՀՀՀժՊЪՀժՂԪЊЊЊЊՂԪЊЊЊЊժԪՊժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժժЪժժՊժՀԪժՀՀՀՀՊԪժՀՀՀՀՊժՀժՂԪЊՀժՊժԂժժՂЊՀԂՊЪՀժժЪժՊԪժՂԪՂժժՊЪՀժՂԪЊЊЊЊЊՀՀЊԂՂԪЊЊЊЊժԪժժժՂԪժЪՀժԂԂԂԂЪՀժԂԂԂԂժժՂժՊԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժARAGRAPH 1. Magnetism is a ( ). 1. _______ ANSWER=force 2. What are the things 2. _______ that possess magnetism? ANSWER=magnets 3. Is the Earth a magnet? 3. _______ yes no ANSWER=yes 4. How many poles do 4. _______ magnets ]_e. If a north and south pole are brought together they will attract each other. If a north and north or south and south pole are brought together they will repel each other. --------------------------------------- Type the correct answer on the line. END P MAGNETISM There is a force called magnetism. It can repel objects and it can draw objects together. Magnets are things that possess the force called magnetism. The Earth is a giant magnet. A magnet has two poles, a north and a south pol WORKSHEETS ON A DISK WRITTEN BY: SYLVIA ANDERSON Programmed by: Ann Turner END OF TITLE SCREEN ISK WRITTEN BY: SYLVIA ANDERSON Programmed by: Ann Turner END OF T READING COMPREHENSION/SCIENCE 5 x 2 T 3 yes 2 T x x 2 T 3 no x 2 T x Betty Brown 1 2 2 r x ՂԪЊЊЊЊժՂԪЊЊЊЊժԪՊժժЊՀժժԂЪՀժԂԂԂԂժЪժՀժժՀЪՂժՊЪՀЪժՀժժժժժՊժժժՂԪժՀՀՀՀՊժժՂЊՀЊԂժՂԪժժՂժՊЪՀՊЪՀժЪժԪժՀՀՀՀԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժhave? ANSWER=two 5. If north and north 5. _______ poles are brought together they will ( ) each other. ANSWER=repel 6. If north and south 6. _______ poles are brought together they will ( ) each other. ANSWER=attract JUPITER Jupiter is the largest planet. It is the fifth planet from the sun. The Earth is the third planet from the sun. Jupiter is 11 times bigger than the Earth. The gravity on Jupiter is about two and one-half times stronger than tfhi240,000 miles from the Earth. The surface of the moon is made of rock and dust. The rocks contain many minerals that are found on Earth. There is less gravity on the moon than on Earth. The moon's gravity is about one-sixth of the Earth's. ------------ MOON The Earth has a natural satellite. It is called the moon. The moon and Earth were probably formed at the same time. The moon travels around the Earth in about 28 days. It is nearly 2,000 miles in diameter. The moon is about he Main Menu. 2) When you have completed the work- sheet, the computer will take you back to the Main Menu. You may choose another worksheet or quit at this time. H STUDENT'S WORK- SHEET AS SOON AS IT HAS BEEN COMPLETED. UP TO 100 STUDENT SCORES CAN BE SAVED AT A TIME. 1) Choose a worksheet number from the Main Menu. Follow the directions on each worksheet. Use the <---- key to delete. Press esc to return to tpt sign ]. WORKSHEET PROGRAM: This program contains 20 worksheets. Each worksheet will be graded as the problems are answered. An x will appear if the incorrect answer is typed. The score is shown in the top right hand corner. THE COMPUTER SAVES EACords Once you have printed the student work- sheets and summary sheet delete them from the disk. 4) Print blank worksheets This allows you to print copies of the worksheets before your students work on them. 5) Quit This will take you back to your promwill print the worksheets that have been saved to disk. The type on the screen is larger than the type on the printed sheet. 2) Print summary of student work This is a list of the students' names, worksheets done, and scores. 3) Delete all student recacdeisk you will press any key until the Main Menu appears. If you want to access the Reports program type 22 to quit. When the prompt key appears type, run reports. EAMPLE: ] run reports REPORTS MENU SELECTIONS: 1) Print all student worksheets This READING COMPREHENSION WORKSHEETS There are two programs on this disk. The Worksheet program gives the work- sheets for students to complete. The Reports program allows the user to print out reports of the completed work. REPORTS: When you boot this dhe gravity on the Earth. It takes 24 hours for the Earth to spin on its axis, that is one day. It takes Jupiter 10 hours to spin on its axis. Ten hours is one day on Jupiter. A year on Jupiter is the same as 12 years on the Earth. ----------------------------------------- Type the correct answer on the line. END PARAGRAPH 1. The moon is a ( ) 1. ________ satellite of the Earth. ANSWER=natural 2. The moon travels 2. ________ around the Earth in 28 ( ). ANSWER=days 3. The moon's gravity is 3., SO MUST REPEAT DOS COMMANDhI15:L$(I):(L$(I),7)"ANSWER="RA$(L$(I),8):NL(Q)I1:I5:800 Y:1:L$(I);:I1AY(37)1YY1 4LM1:UL$"_"6I1(L$(1))8(L$(1),I,1)UL$LMI:I(L$(1)):>L1: allowable leng**********pNC0:I16:A$(I)"":X$(I)"":: NUMBER CORRECT, STUDENT'S ANSWERS, X MARK FOR WRONG ANSWERS~Y(37)2Q1624:(4)"READ "F$: OTHERWISE FILE INPUT WIPES OUT TEXT ON SCREEN LINE WHERE CURSOR LOCATED; "GET" USED FOR INPUTNA$A$. ********** open file **********A(4)"CLOSE":PF$"WS"B$qI120:PAR$(I)""::I0:Y0:(4)"OPEN "F$:(4)"READ "F$L$:L$"END PARAGRAPH"NLI:710II1:I:1:L$;:PAR$(I)L$:690  ********** SHOW QUESTIONS B$"22"ė:12:19:"BYE!":SEC2:59000:< :B$"21"ī200] N(B$)1(B$)20ĺ(7):550z X GET STUDENT'S NAME b:1:1:"What is your name? _______________" lAY1:LM20:L15: CURSOR Y AND X LOCATION, LENGTH OF ANSWER v8000"8) Page Eight":12:21:"18) Page Eighteen"f 13:2:"9) Page Nine":13:21:"19) Page Nineteen" 14:1:"10) Page Ten":14:21:"20) Page Twenty" 16:12:"21) See directions" 17:12:"22) Quit" &19:1:"What is your choice ";B$* 021:"13) Page Thirteen"P 8:2:"4) Page Four":8:21:"14) Page Fourteen" 9:2:"5) Page Five":9:21:"15) Page Fifteen" 10:2:"6) Page Six":10:21:"16) Page Sixteen" 11:2:"7) Page Seven":11:21:"17) Page Seventeen". 12:2:63000/  ********** MENU **********J 16368,0:(4)"CLOSE"~ :1:20(TI$)2:TI$:3:13:"MENU SELECTION" 5:2:"1) Page One":5:21:"11) Page Eleven 6:2:"2) Page Two":6:21:"12) Page Twelve" 7:2:"3) Page Three":7:RACHEL 1 0 2 THING X 2 FORCE X 2 YES X 2 2 X 3 TOUCH X 3 TOUCH X RACHEL 2 0 3 TRUE X 2 FOURTH X 3 NO X 3 TRUE X 3 TRUE X 3 TRUE X 2 o 6. The moon is about 6. ________ 2,000 miles in ( ). ANSWER=diameter ________ one half of the Earth's. true false ANSWER=false 4. The surface of the 4. ________ moon is made of gold. true false ANSWER=false 5. The Earth is about 5. ________ 10,000 miles in diameter. yes no ANSWER=nth for answer$HILM1(L$(1))@R(L$(1),I,1)UL$LL1F\]f8000: get answerp(A$,1)" "A$(A$,(A$)1):880z(A$,1)" "A$(A$,(A$)1):890A$(Q)A$:A$RA$İ6000:NCNC1:970 ********** WRONG ANSWER **********:AY:40:"X":!I1NL(Q)3X1(L$(I))(L$(I),X,(RA$))RA$ĢAYI1:X:RA$;::I4: FORMERLY DID INVERSE BEFORE PRINT, BUT LOWER CASE NOT RIGHTX$(Q)"X"Q398059200:I1NLI:1:PAR$(I); vx'***************************************('Lawful users of this program are hereby$%licensed to read data from its medium$%for the express purposes of executing$"the program. Copying, selling, or$&otherwise distributing this program is$prohibi=(BLOAD TITLE.PIC,A$2000$lWlPl?lSJ||L|6ol6|6 CHR$ (127) THEN GOSUB 59100: GOTO 8015DCTMLİ59100:8015gCV:X:IC$;:CTCT1:A$A$IC$q8015CT0İ59100CT0CTCT1:XCHCT:CV:X:(95):A$(A$,1,(A$)1)8015CT0İ59100:8010x ********** TIM VERTICAL AND HORIZONTAL POSITIONS2O16368,0>TXCHCTN^CV:X:IC$\hIC(IC$)krIC27420|IC13CT0ı: DONEIC88120 IF IC$ > = "a" AND IC$ < = "z" THEN IC$ = CHR$ (IC - 32), IF IC$ < " " OR IC$  IF G = 0 THEN POKE 940,50600 / 200: POKE 941,21 * 6: CALL 942I@ ********** INPUT ROUTINE FOR LIMITED WORD LENGTH **********A(4): SO CAN USE GET$JMLL:A$"":CT0:CVAY:CHLM: MAXIMUM LENGTH, COUNT OF CHARACTERS ENTERED, CURSORAll done, "NA$"!":LM(20(P$)2)1:8:12:LM:P$_:14:12:"Your score was "NC;"."<16:10:"Are you ready for more?"B59200L420p ********** SOUND EFFECTS **********zREP13:940,50600(300REP150):941,212:942:CDAT":(4)"WRITE NS.DAT":NSNS1:NS:(4)"CLOSE": NUMBER OF STUDENT WORK SHEETS STORED ON DISK(4)"CLOSE":(4)"OPEN STUDENTS.DAT":(4)"APPEND STUDENTS.DAT"NA$:B$:NC:I16:NL(I):A$(I):X$(I):$(4)"CLOSE".SEC1:59000(3P$"Y(37)2Q:24:10:"ONE MOMENT, PLEASE...";c ********** store scores **********sNS0:1020(4)"CLOSE":(4)"OPEN NS.DAT":(4)"READ NS.DAT":NS:(4)"CLOSE":103063000: ##### RESUME 1030c(4)"CLOSE":(4)"OPEN NS.ted by law.$fd$f d$fd COMP ED COPYRIGHT 1990$fdCOMP ED$fdP.O. BOX 35461$fd PHOENIX, ARIZONA 85069$fd1-800-347-4242$ RUN WRKSHEET$fdPRESS ANY KEY TO CONTINUE...l|J 17348192lE,ln0$ 4   lfd4BJj J {J J  # CJ # Cfd4 Ҟ  CJ # J fd_$4 ž $CLOSE$CLOSE$OPEN STUDENTS.DAT$APPEND STUDENTS.DAT$ $$$$$$0CLOSE$  4Қ All done, ! ̪(f d $fd Your score was .$fd Are you ready for more?$ ? f d*00XJ 0 O ? (fd0|%2fd ONE MOMENT, PLEASE...6CLOSE$ OPEN NS.DAT$ READ NS.DAT$?LCLOSE$ 6 CLOSE$ OPEN NS.DAT$ WRITE NS.DAT$J |%0 4_JG 0  Jp 0 *J   4  tJ   4   J   $,f d(X$*J4ҚWS0$OPEN $READ $?4NJ END PARAGRAPHd }fd @0|%fREAD $?NJANSWER=4 fd$fd20) Page Twenty$fd 21) See directions$fd 22) Quit$fdWhat is your choice 4NJ22(f dBYE!$  J21 eJΞΞ$ H(fd"What is your name? _______________$    *4 CLOSE$() Page Five$f d15) Page Fifteen$f d 6) Page Six$f d16) Page Sixteen$f d 7) Page Seven$f d17) Page Seventeen$f d 8) Page Eight$f d18) Page Eighteen$f d 9) Page Nine$f d19) Page Nineteen$fd 10) Page Tenz|}~CLOSE$(fd$fd MENU SELECTION$fd 1) Page One$fd11) Page Eleven$fd 2) Page Two$fd12) Page Twelve$fd 3) Page Three$fd13) Page Thirteen$fd 4) Page Four$fd14) Page Fourteen$f d 5Y#b d 6 OPEN TITLE.TXT$READ TITLE.TXT$?4NCLOSE$ ? 4 WRKSHEET.DIRCLOSE$(OPEN$READ WRKSHEET.DIR$6?4Nfd$J ? ( J ? CLOSE$6 lay on Mars is about the same length of time as a day on Earth. The Earth is about twice the size of Mars. The gravity on Mars is one-third as strong as on the Earth. You could jump higher on Mars than on Earth. --------------------------------------- T MARS Mars is the fourth planet from the sun. The Earth is the third planet from the sun. Mars has two moons. It takes 24 hours or one day for the Earth to rotate on its axis. It takes 24 hours and 37 minutes for Mars to rotate. A d136208520617332409202208245174172376174396@@  CJ # / 0lE lnfdPRESS ANY KEY TO CONTINUE...l!|J!| j 4"!J" J|ޔ  ('SORRY, THERE'S NOT ENOUGH ROOM TO STORE$$'YOUR RECORD. PLEASE TELL YOUR TEACHER.$ O &(!Plea7d REPORTS.BAS - PRINT REPORTS FROM STUDENTS.DATCn63000}xA$(6),X$(6): STORE ANSWERS, X MARKS WRONG ANSWERS:(4)"CLOSE":(4)"OPEN TITLE.TXT":(4)"READ TITLE.TXT":TI$:(4)"CLOSE" LM$" ": LEFT MARGIN FOR WO ",15)*MB$(" "B$,3)PNPC$(" "((100NC6)),3)"%"~RLM$;NA$;:" ";:B$;:" ";:PC$:LCLC1\I118:L$:: ACTUAL STUDENT ANSWERSfLC56ĺ(12):2060p2110z(12):420  ********** delete all records * FOUND!":59200:420"4000::2170: ASSUME EOFJ I13:::vLM$;:"Summary Sheet for "TI$" disk": LM$;"STUDENT NAME WS# SCORE"*LM$;"=============== === =====":LC8>(4)"READ STUDENTS.DAT":NA$:B$:NCHNA$(NA$" of student work **********'2040k(4)"CLOSE":(4)"OPEN STUDENTS.DAT":(4)"READ STUDENTS.DAT":JUNK$: TEST IF EMPTY(4)"CLOSE STUDENTS.DAT":(4)"OPEN STUDENTS.DAT":(4)"READ STUDENTS.DAT"2050:12:8:"NO STUDENT RECORDSL$(1)(L$(1),P1)A$(L$(1),(L$(1))P(A$)1)LLM$;L$(1);" ";X$;lX$"X"ĺ" ";L$(NL1):1280rL2NL:LM$;L$(L):: Q(12)(4)"CLOSE"F$1100((4)"CLOSE"*63000,420 ********** print summary :"Score: ";(100NC6);:"%":P(4)"READ"F$:L$:L$"END PARAGRAPH"1190bLM$;L$:1170qI12::|Q16(4)"READ STUDENTS.DAT":NL:A$:X$(4)"READ"F$:I1NL1:L$(I):I1(L$(1)):(L$(1),I,1)(95)PI:I405DS FOUND!":59200:420"B4000(CAG1320: ASSUME EOFkL(4)"READ STUDENTS.DAT":NA$:B$:NCVF$"WS"B$:(4)"OPEN"F$:(4)"READ"F$: FILE 2`I13::jLM$;:"Name: ";NA$:tLM$;"Disk: ";TI$~LM$;"Worksheet: ";B$!LM$; NS.DAT":NS:(4)"CLOSE"m:"This report will take "NS" pages.":"Do you wish to continue? (Y/N) ";YN$YN$"N"YN$"n"420$(4)"CLOSE":(4)"OPEN STUDENTS.DAT":(4)"READ STUDENTS.DAT": FILE 1.10908:12:8:"NO STUDENT RECORets" 12:1:"5) Quit"B &14:1:"What is your choice ";B$c 0B$"5"ė:12:19:"BYE!"::| N(B$)1(B$)4420 X(B$)1000,2000,3000,7000  ********** print worksheets ********** 1080(4)"CLOSE":(4)"OPEN NS.DAT":(4)"READ :1:20(TI$)2:TI$:3:13:"MENU SELECTION"U 5:11:"For teachers only!" 8:1:"1) Print all student work sheets" 9:1:"2) Print summary of student work" 10:1:"3) Delete all student records" 11:1:"4) Print blank work she*****". 612:10:"COMP ED COPYRIGHT 1990" @16:17:"COMP ED":17:14:"P.O. BOX 35461":18:10:"PHOENIX, ARIZONA 85069":19:14:"1-800-347-4242" J59200  ********** MENU ********** (4)"CLOSE":63000 (4)"PR#0" 16368,04ts medium":"for the express purposes of executing":"the program. Copying, selling, or":"otherwise distributing this product is" ""prohibited by law." ,8:1:"****************************************":10:1:"***********************************RKSHEET PRINTOUTS WS$(20):I120:WS$(I):: 1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20: FOR EASE OF NAMING FILES  ********** PUBLISHER'S PAGE ********** :"Lawful users of this program are hereby":"licensed to read data from i*********K :1:1:"Delete all records:":"Please confirm (Y/N) ";YN$e YN$"N"YN$"n"3060 (4)"OPEN NS.DAT":(4)"CLOSE":(4)"DELETE NS.DAT" (4)"OPEN STUDENTS.DAT":(4)"CLOSE":(4)"DELETE STUDENTS.DAT" :"RECORDS DELETED!":59200  420: ********** PRINTER READY? **********:"TURN YOUR PRINTER ON AND ADJUST THE":"PAPER TO THE TOP OF FORM."59200:(4)"PR#1"X ********** print blank worksheets ********** b:1:20(TI$)2:TI$:3:15:"PRIAT$?LCLOSE$(This report will take  pages.$Do you wish to continue? (Y/N) 4NJNny X(CLOSE$OPEN STUDENTS.DAT$READ STUDENTS.DAT$ (f dNO STUDENT RECORDS FOUND!$ X (6READ STUDENTary of student work$f d3) Delete all student records$f d4) Print blank work sheets$f d5) Quit$fdWhat is your choice 4NJ5(f dBYE!$JΞΞ XΞ 6CLOSE$ OPEN NS.DAT$ READ NS.DP ED$fdP.O. BOX 35461$fd PHOENIX, ARIZONA 85069$fd1-800-347-4242$ CLOSE$6%PR#0$l(fd$fd MENU SELECTION$fd For teachers only!$fd 1) Print all student work sheets$f d 2) Print summexecuting$"the program. Copying, selling, or$&otherwise distributing this product is$prohibited by law.$fd(****************************************$f d(****************************************$f d COMP ED COPYRIGHT 1990$fdCOMQ6%&(CLOSE$OPEN TITLE.TXT$READ TITLE.TXT$?4NCLOSE$4 >0('Lawful users of this program are hereby$%licensed to read data from its medium$%for the express purposes of :K12859230'hK155420: ESCAPE-rE UNEXPECTED ERROR"::"Please report problem to COMP ED:"::"Error # "(222)"occurred at line #"(218)(219)256,:59200: L$,7)"ANSWER="ĺ::7390'LM$;L$173208QC(12)dB$"21"WS20WSWS1:7190m420 CV:CHCT:"_":CV:CHCT:@ ********** PRESS ANY KEY **********J24:7:"PRESS ANY KEY TO CONTINUE...";T16368,0^K(16384)WS$(WS)7*(4)"CLOSE":(4)"OPEN"F$:(4)"READ"F$F4I13::Z>LM$;:"Name: "pHLM$;"Disk: ";TI$RLM$;"Worksheet: ";WS$(WS)\LM$;:"Score:"afL$:L$"END PARAGRAPH"7290pLM$;L$:7270zI12::Q16L$:() Page Ten":14:21:"20) Page Twenty"K16:12:"21) Print all pages"r17:12:"22) Return to main menu"19:1:"What is your choice ";B$B$"22"420(B$)1(B$)21ĺ(7):7140 4000 WS(B$):B$"21"WS1 F$"ws") Page Fifteen"G10:2:"6) Page Six":10:21:"16) Page Sixteen"11:2:"7) Page Seven":11:21:"17) Page Seventeen"12:2:"8) Page Eight":12:21:"18) Page Eighteen"13:2:"9) Page Nine":13:21:"19) Page Nineteen"(14:1:"10NT MENU"<l5:2:"1) Page One":5:21:"11) Page Elevenov6:2:"2) Page Two":6:21:"12) Page Twelve"7:2:"3) Page Three":7:21:"13) Page Thirteen"8:2:"4) Page Four":8:21:"14) Page Fourteen"9:2:"5) Page Five":9:21:"15S.DAT$?4 N?4N? L4 ҚWSOPEN $READ $$0Name:  $Disk: $ Worksheet: $Score: ̮d %$$READ $?4 NJ END PARAGRAPH  $ $0 READ STUDENTS.DAT$?L?4N?4NREAD $?N0J_Z(0Ҽ JX $ $$0$2  $CLOSE $ CLOSE$6% X6CLOSE$------------------ Type the correct answer on the line. END PARAGRAPH 1. The Earth is smaller 1. _______ than Jupiter. true false ANSWER=true 2. Jupiter is further 2. _______ from the sun than the Earth. true false ANSWER=true 3. se report problem to COMP ED:$$Error #|occurred at line #|ڬ|ۖ$$CLOSE$ ? @@@@@@@@@@@ '/ <=K >?tBCNO ,` L蘅`l|J J$ X&(!Please report problem to COMP ED:$$Error # |occurred at line #|ڬ|ۖ$` 1234567891011121314151617181920@@@@@@@@@@@me: $Disk: $ Worksheet: $Score:$$?4 NJ END PARAGRAPHZ d  $ : $0 ?4 NJ ANSWER= $$  $ t 2  $J21  Xfd_$fdfdPRESS ANY KEY TO CONTINUE...n$fd20) Page Twenty$fd 21) Print all pages$fd 22) Return to main menu$fdWhat is your choice 4NJ22 XJΞΞ $ Y (ΞJ21 4 ҚwsCLOSE$OPEN $READ $$0Na5) Page Five$f d15) Page Fifteen$f d 6) Page Six$f d16) Page Sixteen$f d 7) Page Seven$f d17) Page Seventeen$f d 8) Page Eight$f d18) Page Eighteen$f d 9) Page Nine$f d19) Page Nineteen$fd 10) Page Te$ $PR#1$(fd$fd PRINT MENU$fd 1) Page One$fd11) Page Eleven$fd 2) Page Two$fd12) Page Twelve$fd 3) Page Three$fd13) Page Thirteen$fd 4) Page Four$fd14) Page Fourteen$f d ease confirm (Y/N) 4NJNn+  OPEN NS.DAT$CLOSE$ DELETE NS.DAT$OPEN STUDENTS.DAT$CLOSE$DELETE STUDENTS.DAT$$RECORDS DELETED!$ X(#TURN YOUR PRINTER ON AND ADJUST THE$PAPER TO THE TOP OF FORM.E$=============== === =====$READ STUDENTS.DAT$?4 N?4N? L4 Ҟ  4Қ 4ҾҚ ̮d %   $?4 N0J8 $  ' $ X(fdDelete all records:$PlOPEN STUDENTS.DAT$READ STUDENTS.DAT$?4NCLOSE STUDENTS.DAT$OPEN STUDENTS.DAT$READ STUDENTS.DAT$ (f dNO STUDENT RECORDS FOUND!$ X (6$0Summary Sheet for  disk$$STUDENT NAME WS# SCOR Gravity on the Earth 3. _______ is weaker than the gravity on Jupiter. true false ANSWER=true 4. A day on the Earth is 4. _______ shorter than a day on Jupiter. true false ANSWER=false 5. A year on Jupiter is 5. _______ longer than a year on the Earth. yes no ANSWER=yes 6. The ( ) on Jupiter is 6. _______ stronger than on the Earth. ANSWER=gravity MOON The Earth has a natural satellite. It is called the moon. The moon and Earth were probably formed at the same time. The moon travels around the Earth in about 28 days. It is nearly 2,000 miles in diameter. The moon is about rs to rotate on its axis than it takes the Earth. yes no ANSWER=yes 4. A day on Earth is a 4. ______ little shorter than a day on Mars. true false ANSWER=true 5. Mars is about one-half 5. ______ the size as the Earth. true faype the correct answer on the line. END PARAGRAPH 1. Mars is further from the 1. ______ sun than the Earth. true false ANSWER=true 2. Mars is the ( ) planet 2. ______ from the sun. ANSWER=fourth 3. It takes a little longer 3. ______ for Ma Water is made up of 4. ________ hydrogen and ( ). ANSWER=oxygen 5. If hydrogen is taken 5. ________ away from water will it change the water? yes no ANSWER=yes 6. Is oxygen heavier 6. ________ than hydrogen? yes no ANSWER=yes PARAGRAPH 1. What is the most 1. ________ common element in the universe? ANSWER=hydrogen 2. Matter is only made up 2. ________ of hydrogen. true false ANSWER=false 3. Hydrogen is the 3. ________ lightest ( ). ANSWER=element 4. h oxygen in water. Hydrogen is often combined with carbon. If a strong electric current is sent through water the hydorgen will leave the oxygen. It can then be collected. --------------------------------------- Type the correct answer on the line. END HYDROGEN The most common element in the universe is hydrogen. Seventy-five percent of all matter is made of hydro- gen. Hydrogen, as a gas, is tasteless, ordorless, and colorless. It is the lightest element. Hydrogen is combined wity240,000 miles from the Earth. The surface of the moon is made of rock and dust. The rocks contain many minerals that are found on Earth. There is less gravity on the moon than on Earth. The moon's gravity is about one-sixth of the Earth's. ------------vide again and again into smaller tubes in the lungs. Millions of tiny air sacs are at the end of the smallest tubes. Air fills the air sacs. Some of the oxygen from the air passes into your bloodstream. ---------------------------------------- Type the LUNGS There are two lungs in your body. One is on each side of your chest, under your ribs. When you breathe in air, it travels down the trachea tube. This tube divides into two bronchial tubes. One goes to each lung. These tubes di yes no ANSWER=yes 4. The liver is on the 4. _______ ( ) side of the body. ANSWER=right 5. The liver cleans ( ) 5. _______ and wastes from the blood. ANSWER=poisons 6. The liver produces ( ) 6. _______ for digestion. ANSWER=bile answer on the line. END PARAGRAPH 1. The liver is an organ 1. _______ in the body. true false ANSWER=true 2. The stomach is larger 2. _______ than the liver. yes no ANSWER=no 3. The liver is a very 3. _______ useful organ.d. It makes bile which is needed for digesting fatty foods. The liver also takes extra sugar from the blood and changes it so it can be stored. The liver releases the sugar when the body needs it. --------------------------------------- Type the correct THE LIVER The largest organ in the human body is the liver. It weighs about three and one-half pounds (1.5 kilo- grams). It is on the right side of the body, above the stomach. The liver cleans poisons and waste products from the blooo ANSWER=no 6. The moon is about 6. ________ 2,000 miles in ( ). ANSWER=diameter 3. ________ one half of the Earth's. true false ANSWER=false 4. The surface of the 4. ________ is made of rocks and gold. true false ANSWER=false 5. The Earth is about 5. ________ 10,000 miles in diameter. yes n-------------------- Type the correct answer on the line. END PARAGRAPH 1. The moon is a ( ) 1. ________ satellite of the Earth. ANSWER=natural 2. The moon travels 2. ________ around the Earth in 28 ( ). ANSWER=days 3. The moon's gravity is correct answer on the line. END PARAGRAPH 1. How many lungs are in 1. _______ your body? ANSWER=two 2. Are your lungs behind 2. _______ your stomach? yes no ANSWER=no 3. Air first travels down 3. _______ the ( ) tube. ANSWER=trachea 4. ------------- Type the correct answer on the line. END PARAGRAPH 1. Humidity is the amount 1. ________ of water ( ) in the air. ANSWER=vapor 2. When water evaporates 2. ________ it changes to a ( ). ANSWER=gas 3. Cold air holds less 3. ________ wamuch water as it can it is at its dew point. If the air is holding 75 per- cent of the water vapor that it can hold then the relative humidity is 75 per- cent. That means that the air can still hold 25 percent more water vapor. -------------------------- HUMIDITY Humidity is the amount of water vapor in the air. When water evapor- ates from bodies of water on the Earth it changes to a gas called water vapor. Warm air can hold more water vapor than cold air. When the air is holding as ) beat 6. ______ slows during hibernation. ANSWER=heart dy temperature falls. true false ANSWER=true 4. The body temperature of 4. ______ a bear falls during the winter. true false ANSWER=false 5. An animal's breathing 5. ______ ( ) down during hiberna- tion. ANSWER=slows 6. An animal's (- Type the correct answer on the line. END PARAGRAPH 1. Many animals hibernate 1. ______ during the ( ) months. ANSWER=cold 2. When animals hibernate 2. ______ they fall into a deep ( ). ANSWER=sleep 3. When an animal hiber- 3. ______ nates its boroundhogs, and bats are some animals that hibernate. Bears, raccoons, and skunks don't really hibernate. They sleep much of the winter. Their heart beat and breathing slows but their body temperature does not fall. -------------------------------------- HIBERNATION Many animals spend the cold months hibernating. They fall into a deep sleep. Their breathing and heartbeat slows down. Their body temperature falls. The fat in their bodies is used for energy while they sleep. Hamsters, gHow many bronchial 4. _______ tubes are there? ANSWER=two 5. Does oxygen pass into 5. _______ your bloodstream from your lungs. yes no ANSWER=yes 6. Air fills the air ( ) 6. _______ in your lungs. ANSWER=sacs ter vapor than warm air. true false ANSWER=true 4. The ( ) point is 4. ________ when the air cannot hold any more water vapor. ANSWER=dew 5. The ( ) is related to 5. ________ the amount of water vapor the air can hold. ANSWER=humidity 6. At 80 percent humidity 6. ________ the air can still hold ( ) percent more water vapor. 20 or 30 ANSWER=20 false ANSWER=false =three 4. Spiders have eight legs, 4. _____ therefore spiders are insects. true false ANSWER=false 5. All insects have six 5. _____ legs. true false ANSWER=true 6. All insects have two 6. _____ pairs of wings. truer on the line. END PARAGRAPH 1. All insects are exactly 1. _____ alike. true false ANSWER=false 2. The exoskeleton is on 2. _____ the inside of an insect's body. yes no ANSWER=no 3. Adult insects have ( ) 3. _____ body parts. ANSWER The adult insect has three body parts: the head, abdomen, and thorax. The thorax is the middle part of the body. Most insects have two pairs of wings. All insects have three pairs of legs. --------------------------------------- Type the correct answe INSECTS There are about one million known kinds of insects. Insects come in many sizes, shapes, and colors. They all have certain features that they share. They have an exoskeleton (an tough covering) on the outside of their bodies.R=yes 4. Icebergs are made from 4. _____ ( ) water. ANSWER=fresh 5. Most of an iceberg is 5. _____ above the water. yes no ANSWER=yes 6. Do icebergs stay frozen 6. _____ forever? yes no ANSWER=no rrect answer on the line. END PARAGRAPH 1. Icebergs are the same 1. _____ as glaciers. yes no ANSWER=no 2. Huge blocks of ( ) 2. _____ break off of glaciers. ANSWER=ice 3. Water is heavier than 3. _____ ice. yes no ANSWE fresh water. The largest icebergs come from Antarctica. About one-ninth of an iceberg is underwater. We can only see the part that is above the water. An iceberg will melt as it gets in warmer water. --------------------------------------- Type the co ICEBERGS Glaciers and sheets of ice go deep into the sea waters in polar regions. Huge blocks of ice will break off of these. These blocks of ice are called icebergs. Ice is lighter than water, so icebergs float. The ice is made from HEART Your heart is a pump in your chest. It beats all the time. It sends blood out to the body and to the lungs. A person can only live about 10 minutes if their heart stops beating. The heart is divided into two halves. Each ha FISH There are many different sizes, shapes, and colors of fish. All fish are vertebrates. This means they have a backbone. Most fish have scales on their bodies. Fish are cold-blooded animals. This means that their body temperatulled blimp 6. ______ rises. yes no ANSWER=yes Gravity holds helium 3. ______ onto the Earth. true false ANSWER=false 4. Air is heavier than 4. ______ helium. yes no ANSWER=yes 5. Helium burns very 5. ______ easily. true false ANSWER=false 6. A helium fi ---------------------------------------- Type the correct answer on the line. END PARAGRAPH 1. Helium is the ( ) 1. ______ most common element. ANSWER=second 2. Helium is only found 2. ______ on the Earth. true false ANSWER=false 3. rises above the air. It is so light that it escapes from the Earth's gravity. Helium does not burn. It also does not combine easily with other elements. Blimps are filled with helium. A helium filled balloon will rise because helium is lighter than air. HELIUM The second most common element in the universe is helium. The most common element is hydrogen. It is found in the galaxies, in the stars, in the air, and in places where there is natural gas. Helium is lighter than air, so it heart is divided 4. ______ into two ( ). ANSWER=halves 5. Each half of the heart 5. ______ has a ventricle and an ( ). ANSWER=atrium 6. The ventricle is thin- 6. ______ walled. true false ANSWER=false RAPH 1. The ( ) is a pump. 1. ______ ANSWER=heart 2. Does your heart beat 2. ______ the whole time you are alive? yes no ANSWER=yes 3. A person can live for 3. ______ ten hours is their heart stops beating. yes no ANSWER=no 4. The lf has a ventricle and an atrium. The ventri- cles are muscular rooms in the lower part of the heart. The atriums are thin-walled rooms in the upper part of the heart. --------------------------------------- Type the correct answer on the line. END PARAGre is about the same as the temperature of the water they live in. Fish need oxygen. Most fish get oxygen from water. The water goes in their mouth and flows over gills. The gills remove the oxygen from the water. ---------------------------------------e. END PARAGRAPH 1. The Earth is the ( ) 1. _______ planet from the sun. ANSWER=third 2. How many hours are 2. _______ there in one day? 24 or 365 ANSWER=24 3. How many years does it 3. _______ take for the Earth to travel around the sun? on around the sun. This is one year. Gravity holds everything onto the Earth. About seven-tenths of the surface of the Earth is covered with water. The rest of the surface is land. ---------------------------------------- Type the correct answer on the lin THE EARTH The Earth is the third planet from the sun. The Earth is about 8,000 miles (13,000 kilometers) around. It takes the Earth 24 hours, or one day to rotate on its axis. It takes 365 and one- fourth days for the Earth to revolve. ANSWER=waves 4. The middle ear is 4. _______ called the ( ). ANSWER=eardrum 5. The eardrum cannot 5. ______ move. true false ANSWER=false 6. There is a liquid in 6. ______ the ear. true false ANSWER=true the correct answer on the line. END PARAGRAPH 1. The eardrum is in the 1. _______ outer ear. true false ANSWER=false 2. The inner ear is shell- 2. _______ shaped. true false ANSWER=false 3. Sound ( ) hit the ear- 3. _______ drumback and forth. The eardrum pushes against 3 little bones: the anvil, the hammer, and the stirrup. The pumping movement of the bones starts a membrane moving. This causes a liquid to push against tiny hairs. --------------------------------------- Type THE EAR The outer part of the ear is shaped like a shell to collect sounds. The in- ternal part of the ear is divided into a middle ear and the inner ear. The middle ear is called the eardrum. As sound waves hit the eardrum it moves odies. true false ANSWER=false 4. Fish are ( )-blooded 4. _____ animals. ANSWER=cold 5. Do fish need oxygen? 5. _____ yes no ANSWER=yes 6. The ( ) on a fish 6. _____ take the oxygen from the water. ANSWER=gills Type the correct answer on the line. END PARAGRAPH 1. All fish are alike in 1. _____ some ways. true false ANSWER=true 2. Do all fish have back- 2. _____ bones? yes no ANSWER=yes 3. All fish have scales 3. _____ on their be two ANSWER=one 4. What holds everything 4. _______ onto the Earth? ANSWER=gravity 5. There is more land on 5. _______ the Earth than water. true false ANSWER=false 6. There is about the same 6. _______ amount of water as land on the Earth. true false ANSWER=false DELTAS Rivers empty into large bodies of water. A delta is the flat land region that forms where the river empties. This land forms from the soil that the river leaves behind. Rivers carry sedi- ment. Sediment is particles of plant 4. Silver is used more 4. ______ than copper. true false ANSWER=false 5. Copper ( ) are found 5. ______ all over the world. ANSWER=mines 6. Copper has only been 6. ______ used for a short time. true false ANSWER=false t answer on the line. END PARAGRAPH 1. Copper is a ( ). 1. ______ ANSWER=metal 2. Copper is the ( ) best 2. ______ conductor of electricity. ANSWER=second 3. Silver is less expen- 3. ______ sive than copper. true false ANSWER=falsethan silver. Most electrical wiring is made of copper. There are copper mines all over the world. People have used copper for more than 5,000 years. Usually other elements are combined with copper. --------------------------------------- Type the correc COPPER Copper is a metal. It is reddish- orange in color. It is a soft metal. Silver is the best conductor of elec- tricity. Copper is the second best conductor of electricity. Copper costs much less than silver so it is used more ial 4. ______ that covers the eye is called the ( ). ANSWER=cornea 5. The back wall of the 5. ______ eye is called the ( ). ANSWER=retina 6. The ( ) in the eye 6. ______ forms the picture. ANSWER=lens e. END PARAGRAPH 1. Tear help to protect 1. ______ the eye. true false ANSWER=true 2. The ( ) lets light 2. ______ into the eye. ANSWER=pupil 3. The colored part of the 3. ______ eye is called the ( ). ANSWER=iris 4. The clear mater material called the cornea. The pupil is the black hole in the center of the eye. It lets light into the eye. The lens in the eye forms a picture on the back wall, or the retina. --------------------------------------- Type the correct answer on the lin THE EYE The eye is protected by the eye- socket, eyelashes, and eyelids. The eyelashes help to keep dirt and dust from getting into the eye. Tears help to wash dirt away. The colored part is called the iris. It is coverd by a clearmaterial, clay, sand, and gravel. A fast moving river will carry more sedi- ment than a slow moving river. The river slows suddenly as it meets a still body of water. As the river slows the sediment falls to the bottom forming a delta. -----------------lse ANSWER=true 6. Gravity is weaker on 6. ______ Mars than it is on Earth. true false ANSWER=true were made 4. ________ ( ) of years ago. ANSWER=millions 5. Diamonds are one of 5. ________ the softest materials. true false ANSWER=false 6. Liquid ( ) carried 6. ________ the diamonds to the earth's surface. ANSWER=rock ct answer on the line. END PARAGRAPH 1. A diamond is a ( ). 1. ________ ANSWER=crystal 2. Diamonds are abundant 2. ________ on the Earth. true false ANSWER=false 3. Diamonds are made from 3. ________ pure ( ). ANSWER=carbon 4. DiamondsDiamonds were made in the earth millions of years ago. High tempera- tures and the pressure of the earth turned carbon into diamonds. Diamonds were carried to the surface of the earth by liquid rock. --------------------------------------- Type the corre DIAMOND A diamond is a crystal. It is made from pure carbon. Diamonds are the hardest known material. They have the highest melting point of any known material. Diamonds are very rare. They are very expensive and very beau- tiful. where 6. ________ a river empties into a large body of still water. ANSWER=delta delta. true false ANSWER=false 4. A river speeds up 4. ________ when it empties into still water. true fasle ANSWER=false 5. Do rivers empty into 5. ________ large bodies of water? yes no ANSWER=yes 6. A ( ) will form--------------- Type the correct answer on the line. END PARAGRAPH 1. A flat land region at 1. ________ the end of a river is called a ( ). ANSWER=delta 2. Rivers carry ( ). 2. ________ ANSWER=sediment 3. Sediment is the same 3. ________ as a of water that branch off the Pacific. It is the world's deepest ocean. There are mountains, valleys, and volcanoes in the Pacific Ocean. It is the world's largest habitat for marine life. --------------------------------------- Type the correct answer o THE PACIFIC OCEAN The world's largest ocean is the Pacific Ocean. It extends from the cold Arctic to the warm tropics to the cold Antarctic. The Pacific Ocean covers about one third of the earth'surface. Gulfs and seas are smaller bodies lse ANSWER=true 6. Gravity is weaker on 6. ______ Mars than it is on Earth. true false ANSWER=true rs to rotate on its axis than it takes the Earth. yes no ANSWER=yes 4. A day on Earth is a 4. ______ little shorter than a day on Mars. true false ANSWER=true 5. Mars is about one-half 5. ______ the size as the Earth. true faype the correct answer on the line. END PARAGRAPH 1. Mars is further from the 1. ______ sun than the Earth. true false ANSWER=true 2. Mars is the ( ) planet 2. ______ from the sun. ANSWER=fourth 3. It takes a little longer 3. ______ for Mayue 2 fourth 3 yes 3 true 3 true 3 true 3 3 5 3 true 3 true 3 true 3 false 3 no X 3 gravity 4 4 6 3 true 2 negative 3 false 3 false 2 water 3 magnet 5 5 6 3 true 3 no 3 yes 2 right 2 poisons 2 bile 6 6 6 2 two 3 no 2 trachea 2 two no 3 false 3 yes 20 20 4 3 false 3 true X 3 yes 3 true 3 yes 2 Mercur X 2 2 6 3 no 3 no 3 one 3 no 3 false 2 four 17 17 6 3 yes 3 yes 3 true 2 third 3 false 3 marine 1 1 6 2 force 2 magnets 2 yes 2 two 3 repel 3 attract 2 2 6 3 tr false 3 yes 2 oxygen d 15 4 2 three 3 false 2 igneous 3 no 3 yes X 3 surfac X 16 16 4 2 energy 2 atoms 2 nucleu X 3 forces 2 fissio X 3 false 18 18 6 3 false 2 nerves 2 glucose 3 oxygen 2 contract 2 elastic 19 19 4 3 nerves 2 X 0 X 3ne 3 true 2 four 3 no 3 false 2 true 10 10 6 3 bounce 3 echo 3 false 3 false 2 shape 2 water 11 11 6 3 yes 2 rises 3 true 3 true 2 water 3 no 13 13 6 2 backbones 3 false 2 no 2 meat 2 cold 3 false 14 14 5 3 true 2 air X 2 carbon 3un the line. END PARAGRAPH 1. The Pacific Ocean 1. ______ extends from the top of the earth to the bottom. yes no ANSWER=yes 2. People in cold climates 2. ______ and people in warm climates live near the Pacific. yes no ANSWER=yes 3. The Atlaalse 6. There is a great 6. ______ amount of ( ) life in the Pacific Ocean. ANSWER=marine ntic Ocean is 3. ______ smaller than the Pacific. true false ANSWER=true 4. The Pacific covers 4. ______ about one ( ) of the earth. ANSWER=third 5. The land is all level 5. ______ in the Pacific ocean. true false ANSWER=f