8L2C)pJJJJ IH(ȱH:=IH[H`@HcH  $ +   I/H`JLNGȄBȄF aK  haaFF  mJm# KKJ UJ )J ۈ) ;J3ȱJFȱJGJKaȄM  aaNNJFLGJL LL !Cb" %n"o" (#M8( % ) L'"p"q" (\4, )7(P0  ( @p 8  x"!b"i"0 ~&i"0 %r"s" (,) &Սt"u" ( %L'")0I0hx H( +kk`?00$WS19(  0$WS2000$WS17c00$WS11F  0$WS12%  0$WS13   0$WS14!00$WS15N  0$WS1600$WS1800#WS4_00#WS5^00#WS6400#WS700#WS8=  0$WS10\00(WRKSHEET{ 2 & 9REPORTS.BAS '+'REPORTS '9INPUT.ANYTHINGK1 E #WS200#WS3g00#WS9  0,WRKSHEET.DIRb 0STARTUP.BASg'+WRKSHEET.BASk r'+NS.DAT` +'STARTUPwC'0STUDENTS.DATu +WRKSHEET'' &PRODOS }<' /COMPILER.SYSTEM(#C'1()TITLE.PICK ' $ TITLE.TXT[i00COMPED.CS\00#WS1^? &PRODOS `DaElH$?EGvѶK+`L HHLy XP LM ŠϠĠӠS)*+,+`F)) (*=GJFjJJA QE'+ '== `@ STSP8QSS8 m P o R(8R %Щ ߩx"L! )L! 8'  )ɀ)4,- U JNT) x"Lv"w" ( !` a"M)Fi/ e"3 k"  !"#$%&آ <B*IBGF08Lé'+8H <,``h(`@ڍL3<>=?<>CAB@?A` 1 L  <>`ڢF]PL8i m L   6< L  BLRAM' hLDLHB-9F 3"aɿ LLB Nϰ H  @h( L Lj  @`eLJCAB@=?.<ʆ>,=?BC8 é&'112``* G** c*` v* G* c*`hh8`8`***`}*`e`H)hJJ*0JJ)` (< ( < *? ( < (? ( < (? ( <*? * **? *? *? ( < *? ( <ȱȱȱȱ0]cȱeem*ȱ*ȱ**ȱ**ȱ* )* * )L(`L?* *Ll) ) L( )Ll)8e` ,$`ee` < @( )m((.(( M(i ``) |'(j21 z& {&!` ({&z&(i({&(( CBDFGE (r&$ 3(,}&r& … 3(ŅL&JJJJ`Ϡ'8`r&h)hr')L&18|&"m11 2H22h2舌|&|&12H)M0 h10200I20h2 (`LE%12 `_'"L  <8# ȱ)ɀ  )( ` (Xp0`ŠӠֱҭԠŠҬî̠ӠĮʎ1|&… (n}&Dž (\%Tz&Lc()8= (J 8'z&'{& 3((ʎ1|&|&|&3223 `%YYZLYLYLY뿭` 8!@8` %MNЩUMߩ  L 5   8 0 8  `0 / X& & +&&7&P^& S ɘL   V7 L ' 0% '8 Jm ʈ0  0ŠϠĠ͢Š͠͠ϠŠŠϠĠخ͠ ͍B B(8. ) ɘ"    L=#=#&ŠϠĠԠŠ ԩ m# m# J Qڨ)̰m] нȱ ̀𩠙 i F >l"m" h" iL X%;"L8"ΠΠҠ`y""""""*$ Fk%YeQP!/RB}QBiBB}\ ĉFEL/#> ț6 hh@ihAiH(ؠȱ@JJJJq@)@Yvȱ@Hȱ@Ah@y@cYe J) LL LJiB LJ) >xhHHHHL(  ްƠx@BEOD  ް(`( C)CJJJlB O-`J,~@~@}J@` ߩ%S @ ~`E hhhߺ0 h ߐ( ߐ ߐ ߐ  0 HϭߍLпllllIL/FHGI ҭJjHIHB>IؙJJ W: ELyHIHI`JKJK`FHIG ( Ȣ؝؈JL)eKM`)` J zJ͟ $0 ΎJFJL8`JGBJ P ؑ@`M8`8@ؐʈI묆)z8zz Ly LةC8`؍)@ i)z8zyJ ^ ؅F Lo) +%J(a *FإGؐ.` *JHIH ۩ ٰz{`JJJJ;i v묅͚ vٍ0  `H8` `ٍyٍiB0H0FG h0`FG `ϩBxED0C ް(`(8`{ `ٽJJJJ`H͐hn)NjNjNjN. CH͐ v;٭ *Nۙ۰ڙک `Z8` C# (`{ .{ .{ .{8۰*Jzܝ٭(ܝ`)َ 8ʈ` 0ٝ)i `8`R ꍐz{ vNمFمG < ΐ0 FGL鮅0 ٭{٭zٽ8`H8`  ,z { 8` z E8`1ݾ00 Y 0ʩ 谼 谷`12)1`0`Ȏi 0U`)8`ά` W xG 0A)H ܝʈh٭0٭)ܝ٭*ܝ٥F٥G٭'ȱHά`Ύ8EeHI |SB:0M ٙKٙIFNGʈ d献`8m0`,0H hi PȽάhٍ0GF8yאFG  $0 G01܅I `P܍QR d8D`F` ]lH)HFȍNHGO $%܍&܍!ܢ8* J8` L ܝ>)I 'ܝ:`F8iRFPGQ`F܅IH3H ( )O 밨G%܈D" T)Ii)܍R*܍E'ܮ( 4 䭐 $H %HFFHGHG 됬`R8`)` EHS` #Q'܅IHHSSЍS@`8 ` ͍% ΍Q8`ʈ@qȱ@cȱ@mopfNxOyS)5SI0ܢܽ iP'E* 7deFG (GH Lv܅IR mEIH` tq qM0PQ ESHNFOG 밳NN` G8`F@ 0 > LK8`: ;I8`FHGH hGhF܌ բFܽܕF芝ܝ 밶:; <܅I m=IHHyHȘI Lܝ` @c@ k@Ю׍S)mיSi 뎅`C8` @ r3N@) G莱 ⭮i`0 Y; 뮅ٝ٘ 0 W,0 .H hȑNWȮّNW8`ٍّNά0N뎒׮Б` L` @>S)I38Mdeם`K8`@Nȱ@O@ rIiNȽבN)/ȩ/N`@[ WHJjjjhA ,'KI؍0JHhh8` Qx")T'P) ɺiL; )?     ~ `l@Hȱ@IױHXATȱH ɯȩ׍̒5H)/@a)_ .0 :A[8@`,FإG`BH PFإG`,H hHB؅F  ؅GxDE؍00C ް(`(8` vL'J  6"L vH  6 9ؙ` @ P8`K8`B8` L؈SJJJJحq) ) )Ю ЪGdF $ ᭔ع+ؠ 2H  :h8` 䮅ٽ ٬ؠ@` ( L )8`)i п` H h)N$%hꭋILhH),Nx8 (8` ԍ`@ABe 2U,,CnZ1IJK,-NOPQRSuHUSTON!' @  K cXXK تKo`V8`no` , on cI9XX`)HJJJh`OeNeO࿰ c9XАO`@ȭ@` ON INJKO`Hх 밽܅F݅G ` c* Z% L`L뮴HH hFhG܍ݍ 8 `FHGH  hGhF`ݹܙ݊`@Bɼ>K@J5 c9X(N    ܮ `J HH hh` 0 @ L/L Z`̸Yܝ ݝ0̸ȩFG   0` ܅F݅G ` c Zͬ LȹL@ȅH@IL,0` G וֹ= YH.q)N 0 >deS)@LP8` D᮴ ֩SGHG v L䬅yٙ٭yٙ٩`K CEdFeG 6%&ȹP8` i` %ם0 B %)( ȹ`8m8m@8` G8`F Pq)@N8`S)@J טyרםSS)׍Sde 밑 Ȣ؝I؈ 2h(8H ( h(8Hh(`ؑ@`@ȱ@ ` B@8ZS d鮅ٍٍٍsHٍr8fhgSJJJJS)S@` %I -q) 0@S)N8` @LL =@ ؝~@~ݞ@ʈL2 KIJHȢݞ)Jn 8 θ ؍ ؍ DH8 ع)ꭵJJJJ )߹0 )p )@ ) ȩ ؝L0NO 방 PQNOFG 嬆؍f؍g؝h ؝c zS) zS )حM͚ v`H@h`h``N8`  ) 1⬆iع `  عiعi` )؍0CGHFHBFG ުhFhG`@4͔ L @Ai ׭2` . :#ع؍0 Y讅)`.@+ i 8` L ؊ PLE΢ʱNLMOMEKP%MEK΢L$ O, PeNNO 2(` C  7 2JzHI{HI؊ }LE  *` A Hz ع H{ ؙ؊ؠIhHIhH } `؝}zIzؐ` f~ؽ؝z f % f؝~z؈` ` H  Ph)N@ 1; L  2$ )bJ Y ) H 4hL )  )حJjI{HIzHNO 8 ؍JL`R΢ʱLN1MOMEKP/MEK΢L7L-M O,p莡eNNO(`JNKOL 2/ "P L8 y WؑJ`L@ȱ@ `@Nȱ@O LL L r L 2 "pJ덣 )@፦NJOK 2iKK΢΢ IJΣ JФ̭JjHFIH HIGxKE ް((H hH h8`8@ȭ@L2쬆8N !"#$Ԡ͠ˠĠԠҠ(c)1983-1987 AppleLKL`BLL ެެެެެެެެެެެެެެެ(C)APPLE'83xLLM Mh@8nЍLޭ 0J @,,LNLG ASTARTUP$#   / XXύX?klmnÍoL) "6L'?"(0`6708" = ***)<0h)ύh0HHHH " ׍hhhhhhh .hh8`JIMJAYKERRY&MIKEFby LҠؠӠ΢ϠԩҠŠƠԠԠŠӢɯϠҠůȠԠĠ  ɈL :Lɍ)ې)ɮ۰ɺH h 'L  ġLL ̹L)'L ȳL O'F ʻ ̹(((L $ʩ $$ $L `ީ % K@D E  / XʩXύX X %   % ɍRH hɛɘɉɈ $ Ld :Ldې)ɮ۰ɺ' Ld  : X ( % ɛ$ɘɉ 8V%֌&8V֌֠)HV)hH)hHIhդD?DRIDQD)҅; ?JDQD]ՎՎՎ`MY pӭY)p  ӭp`C)`BFGV 8``8LխӅ:HhHh Ո թ թ ՘VYҪҦ>:Y)Ң`;R?AJ;<ȰY)Ң`Y?)Ң`ȐҰ ;HhHh=Ң`Hh `Hh`DEiȍ0֌1֍ZԍsԍԍԍԥDEԌ8TԌ8WpԌqԠ 7I꽌ɪ꽌ɭ蠪:љVE:8`]ѾV]H)]ѾV]ҙ)]ѾT]ҙ)] >8hUD` ԝY`> Hh݌(`HCJJJJ)*h`0($ p,&"op8`kkV꽌ɪɖxlӽ*kӽ-kәmMlӈ 꽌ɪ`8` *L o % ԽYӍZӭoӝY 3Ѡ шNZ`rZLkӭZӍq8r7IZӐiZkӐk 8 ѹs ӭq ѹ| kн Z)*>>` @ $(,048<@DHLPTX\`dh 0ުlptx| ֽ ְ& .Vӈ  JJJJH 8h Ei 8EX`'8`jӍWӥC)p> pӥCYӍY 轊( ( ӈBV ( ӭp0 \BkJ ՠ@iӦ> Ӑi'j:ZH i@ioZZH h ѐȭnWǥBJ Ӱ8XӦ>` Ր+>P׽8H  ): e: y8鰕:Jjjj<)yאi8i;i(*=>hPם8`;Zx3QZYXXWV[HEVhEhH)IWHPHHHAHHHLaVEWLӿJJH !h穖tp% ;"Z/݀>">"' 1" 7"5).莀/ ;" " 6" >" 1"6"$ "g"" !"""""Iz HL')*+,-./0123456789:;<=>?@ABCDEFGHIj>>m>` _m8injkiljo풼i>?Ek?>Q>> L> \/ e>>?́?ޱ>ȥpnG @p;G=po:Q>>>̀ `` \> ̀ `e>>?́?>?Emn(>e>ȱ>e?>Q>ؠ> ie>>?`|;}=:<~:<=;`||m};>:8o>oȑ>ppȑ>> :op`G DKJپھ pHJh` D!hgt}~p `~t}p8n~ni}tpi~~tso8pinii>j?k̈́>~|p|Ii||̈́ l - `>i>L8933LΞAAJL ةޘг uv $ 8LƞaЌ>?@`>?@`B8` K  춼LK ҟ ҟ ( KK`HJJJJ8`HK)` #hhL𚾤3 @LtJ)s@J b  l`a?sa?,E30ɍФ3 E3HD F3 Ʉ%h3 bM E  lLthɍLL3`3,A0s0% Ipn DpnI:L ؅303پھ p H־Ǿh۰8L־Jjjjɾ)Ⱦ8 ѱ OLӜ ĤLLX>(F`־ؾپھ׾` bɄ KDEF vLl v lL bKɍKL?` w  vLl@$݅3`(l8L3LX>(Ƀ,`3,G0]ɾ g` H`پ_پ p _پ׾`>( p۾m׾) W)ʩ@`ɾ>(O puȾ ɾ-O ]c־Jjjj `O>0O l PODEF޾ p ޾ p($ذ v (0 ( L?ԦʚLeةީa s  lL b,FLg,DL,C0$3 >@ Ɉ 3ɾꩈL(3ɾ;Ƀ B94 l% bʽ  ՚,S` H EH06172839h` v97L75v^a ?/( va?LLLɍ$?`?a ɍɥAH93827160hH46576879h`,C bL ɍ b w,S0 @ lLޭBYL 8!9 詍` "  à4"/pŠϠŠà͠ӠàԠŬh,PIN'ҍIxy /L6Ix y JpnoF /= plm /w)!,ZJYH)h****)  md8幙`\H[< h  /( 载쳼󩭙L/id /`H) hJJJJ ɺi` M  ` ת.8 `O`S  AI-L9 ᪰B C VWS`޾Lp h־Ҿ,G0^W)TP) ecfdپھ׾ؾӾ p$c d pccddީ 8`ȾɾʾNfne}ȾȾI>Ie f`8` P־ǾҾ,G0C f=W)_``\"׾پӾؾھ pD`־ǾY׾ؾOW)ݩȾɾʾ pD`8`W)CB) 5W) =)W)@! pZ}ȾȾ󰹩 p` ־ǾҾ,G 8`׾ؾ f p vۥs׾tؾE` 67إE` Ln  ` ` ފ `    8` HIihIi` 8` 0`F8` 8ompn` DLȱH z|h L湠H hHHzH|HH L|Ў   ۄ L   Ў   ۄ iL UHH d$ dhh d E0  d` c뤄 L Ў   ۄ L chh L ` ) #L ح 6 7ɐ ⌰8` `؍ 6 7 ۄ L MHH 3湠hh PI Ⱦ`Pp chh  Ў SLT Ў   鎥 % 湠8q` #HH hehep%` chh L Ў   ۄ L(8 8` HH 8h優hp` L |~e~eLׁ8t `Ln湠` 湱` 8`ɐ 릡`  M`Ll 0 `,`0  Lۄ L AL L L L :L L   Ў   L W XYgh ``   "gͪȱgͫȭgg yΣ` 8` gͪ ȱgͫ` 8`s8@I5gN Oz @n[Dz @nd0,~z @`$仫@v$⩔,C[B?I>孓`仫6VtCicQĿUKqtVt Nֵ#ح#׮2}q :IC@@ -!S    !C- !ABELSDFRV@@ !$(19@EüϠž(+@ABCDEFGHIKLMNPSsƬƀ#(ZZV4G_0=( A P FjL\5p-e9ABSAVERIFYBLOADELETEBYECATALOGOPENWRITEXECREATEFRESTORENAMEBRUNLOCKCHAIN#FLUSHREADPOSITIONOMONPR#PREFIXCLOSEAPPEND6D(!쫂8 ( 8о(־Ǿ,G 8`_`W)H־Jjjjh p̭ fLᶢǾ ת..8 ۭ (8mȾȾmɾɾʾiʾ` Lpl8l:/,s̑~z hh|hzhh` \ eL \ L \ [LLl$` \ L \ L3 TL  \ ` v \`H 4h`$ d  0$-`&&8 ` \3 JL \ 2優L3 20 L@i)${L L XL sL wL L L$, ,{(` W80 `L3 )3`  +E:L0 $L  Z Z ,բ 򇅄":,ʅʆȽ Ņń"莤&& ee`湠 Lx) H HLGHH ˌhhHH餍0mzn|hhȥȥȥȌ1 !10Ƥx)P 锐 Ll&m1ȥiHemmhenWnpoHH hhphhhȊȥL ML +LkLn湠8 ┥HH ˌhhHHz|┠hhѕ Dѕ9ȱȱȌ eeкx)P LԔkLn&q~q`xLn8mLL ILؒ  HHH \hhhʊIńLl ȱ` HH hhq36 ؑei`LnL 'x) ȱȱ`L? 'x)HHH nߑ`LȆ8L \H ؑhȑ` ` HH hhї ȱї ї,q`   ؑL vȹ ؑȑ` HH \hh`  hhHH` @#HH 0 J ChhL0:)`3 aL"ȱ)389ȱ \Ą8pn ` WL ؑL` 8e`*Lnߑooppmh` WL :L  MHH \ hh`Ll膄醅ф eȱe`Ll L u L u q` \(  \0`Ll \ \L\ 0(؆, L (ɨ0- (Lstopijklmn S 5hL⎥$ && ee兊` &e`湬Fl \,S,TL慅 ,W,P`@ \,U,RL \L \L \ dL \ LLl \ Lʏ \ 1 L \ Lߏ \ 1 aLH MLn   L \ `8 ˌ./ \3( \1-I)L ˌFG \EL L ˌqr(  Ls pL ˌ` ˌmnsotpL ˌstijLijL/ Le`u` rhhHHH`hh== 8``?LH \h`B B` @`Hegheh` y橊 o АL Cghgg $L gȱg uxy Oxyvw Ovw xu Ǝij`|~`湠z|~`z|~L? АLuz|~`L SLvw`Ln$085$0, Z $L`H \h $ AL򊮟Llɐ 릡` ɐД0榟`)1 o35 K 0 کL \ ieiȱ e$ HHLlL` А vLlئL8pn LlL湠  Ll湠  ~|zL L r륝z %  Lu LLrHzm|hm~pݬ  pP L PI  l,0L\,0 [L ʊ ۄ  ~|zL% ⋭  +  ,0,0  +L `0 +L܈( [L uȌ`ܬ8ȹL `~`L  [L( (`Ln湠 8 L٥ ` :`3 a ,թ,LɃLLn3 ZL LiHiHegȱehLLhh%L  [LhhLLnL   +뤸L 5TFaeJ[Ǐ܏ӏh 9QNvٓK$02 ./y˃$؂CG/ Ғ zxRk_ZjƂςF.\?REENTERLL\LԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժժՊԪՂժЪՀժԂԂԂԂժЪՀժԂԂԂԂժժՂժՊЪЊՀժՂժԂԪժՀՀՀՀՊЪՀՂԂժՂԪժԪժժժժՊժՊժՀժժՂժՊЪՀЊՀЊԂՊЪՀժЪԪժՀՀՀՀժՊЪՀժՂԪЊЊЊЊՂԪЊЊЊЊժԪՊժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժժЪժժՊժՀԪժՀՀՀՀՊԪժՀՀՀՀՊժՀժՂԪЊՀժՊժԂժժՂЊՀԂՊЪՀժժЪժՊԪժՂԪՂժժՊЪՀժՂԪЊЊЊЊЊՀՀЊԂՂԪЊЊЊЊժԪժժժՂԪժЪՀժԂԂԂԂЪՀժԂԂԂԂժժՂժՊԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժs move slower. true false ANSWER=false 2. The slower that mole- 2. _______ cules move the less ( ) they produce. ANSWER=heat 3. The ( ) of moving 3. _______ molecules creates heat. ANSWER=energy 4. When air is heated in 4. _______ ]_ energy is energy of motion. The energy of moving molecules is heat energy. Heat energy is a form of kinetic energy. --------------------------------------- Type the correct answer on the line. END PARAGRAPH 1. If water is heated the 1. _______ molecule HEAT The energy of moving molecules creates heat. The faster the molecules move the more heat they produce. When the molecules in liquid water move faster they create heat, occupy more space, and change to water vapor. Kinetic WORKSHEETS ON A DISK WRITTEN BY: SYLVIA ANDERSON Programmed by: Ann Turner END OF TITLE SCREEN ISK WRITTEN BY: SYLVIA ANDERSON Programmed by: Ann Turner END OF T READING COMPREHENSION/SCIENCE 6 x 2 T 3 yes 2 T x x 2 T 3 no x 2 T x Betty Brown 1 2 2 r x ՂԪЊЊЊЊժՂԪЊЊЊЊժԪՊժժЊՀժժԂЪՀժԂԂԂԂժЪժՀժժՀЪՂժՊЪՀЪժՀժժժժժՊժժժՂԪժՀՀՀՀՊժժՂЊՀЊԂժՂԪժժՂժՊЪՀՊЪՀժЪժԪժՀՀՀՀԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժԪժժժժժժժժժժժժժժժժժժժa hot air balloon does the air take up more space? yes no ANSWER=yes 5. If the air molecules 5. _______ in a hot air balloon are cooled will it deflate? yes no ANSWER=yes 6. Moving energy is called 6. _______ ( ) energy. ANSWER=kinetic ,136,208,5,206,173,3,240,9,202,208,245,174,172,3,76,174,3,96: SOUND ROUTINEw (4)"BRUN INPUT.ANYTHING" "::(4)"OPEN COMPED.CS":(4)"READ COMPED.CS" '320: ASSUME EOF ,L$:L$"END OF TITLE SCREEN"320 6L$:300 2d HELLO - SHOW TITLE WHILE LOADING PROGRAM8nZx(4)"BLOAD TITLE.PIC,A$2000"16297,0:16304,0:16300,0:16301,0(64435)6(64286)76(49206)128Ĺ49206,(49206)128: SLOW GS DOWNX I942962:P:I,P:: 173,48,192he Main Menu. 2) When you have completed the work- sheet, the computer will take you back to the Main Menu. You may choose another worksheet or quit at this time. H STUDENT'S WORK- SHEET AS SOON AS IT HAS BEEN COMPLETED. UP TO 100 STUDENT SCORES CAN BE SAVED AT A TIME. 1) Choose a worksheet number from the Main Menu. Follow the directions on each worksheet. Use the <---- key to delete. Press esc to return to tpt sign ]. WORKSHEET PROGRAM: This program contains 20 worksheets. Each worksheet will be graded as the problems are answered. An x will appear if the incorrect answer is typed. The score is shown in the top right hand corner. THE COMPUTER SAVES EACords Once you have printed the student work- sheets and summary sheet delete them from the disk. 4) Print blank worksheets This allows you to print copies of the worksheets before your students work on them. 5) Quit This will take you back to your promwill print the worksheets that have been saved to disk. The type on the screen is larger than the type on the printed sheet. 2) Print summary of student work This is a list of the students' names, worksheets done, and scores. 3) Delete all student recacdeisk you will press any key until the Main Menu appears. If you want to access the Reports program type 22 to quit. When the prompt key appears type, run reports. EAMPLE: ] run reports REPORTS MENU SELECTIONS: 1) Print all student worksheets This READING COMPREHENSION WORKSHEETS There are two programs on this disk. The Worksheet program gives the work- sheets for students to complete. The Reports program allows the user to print out reports of the completed work. REPORTS: When you boot this dfhi @5000A J ********** PUBLISHER'S PAGE **********r OS$"***************************************" T:"Lawful users of this program are hereby":"licensed to read data from its medium":"for the express purposes of executing":"the progra, SO MUST REPEAT DOS COMMANDhI15:L$(I):(L$(I),7)"ANSWER="RA$(L$(I),8):NL(Q)I1:I5:800 Y:1:L$(I);:I1AY(37)1YY1 4LM1:UL$"_"6I1(L$(1))8(L$(1),I,1)UL$LMI:I(L$(1)):>L1: allowable leng**********pNC0:I16:A$(I)"":X$(I)"":: NUMBER CORRECT, STUDENT'S ANSWERS, X MARK FOR WRONG ANSWERS~Y(37)2Q1624:(4)"READ "F$: OTHERWISE FILE INPUT WIPES OUT TEXT ON SCREEN LINE WHERE CURSOR LOCATED; "GET" USED FOR INPUTNA$A$. ********** open file **********A(4)"CLOSE":PF$"WS"B$qI120:PAR$(I)""::I0:Y0:(4)"OPEN "F$:(4)"READ "F$L$:L$"END PARAGRAPH"NLI:710II1:I:1:L$;:PAR$(I)L$:690  ********** SHOW QUESTIONS B$"22"ė:12:19:"BYE!":SEC2:59000:< :B$"21"ī200] N(B$)1(B$)20ĺ(7):550z X GET STUDENT'S NAME b:1:1:"What is your name? _______________" lAY1:LM20:L15: CURSOR Y AND X LOCATION, LENGTH OF ANSWER v8000"8) Page Eight":12:21:"18) Page Eighteen"f 13:2:"9) Page Nine":13:21:"19) Page Nineteen" 14:1:"10) Page Ten":14:21:"20) Page Twenty" 16:12:"21) See directions" 17:12:"22) Quit" &19:1:"What is your choice ";B$* 021:"13) Page Thirteen"P 8:2:"4) Page Four":8:21:"14) Page Fourteen" 9:2:"5) Page Five":9:21:"15) Page Fifteen" 10:2:"6) Page Six":10:21:"16) Page Sixteen" 11:2:"7) Page Seven":11:21:"17) Page Seventeen". 12:2:63000/  ********** MENU **********J 16368,0:(4)"CLOSE"~ :1:20(TI$)2:TI$:3:13:"MENU SELECTION" 5:2:"1) Page One":5:21:"11) Page Eleven 6:2:"2) Page Two":6:21:"12) Page Twelve" 7:2:"3) Page Three":7:jlmnopqrst DIRECTIONS IN MENUC ********** DIRECTIONS ********** F$"WRKSHEET.DIR":(4)"CLOSE"::(4)"OPEN"F$:(4)"READ WRKSHEET.DIR" Y0 280 L$ YY1:Y:1:L$ Y21İ59200:Y0: 240 Y0İ59200 "(4)"CLOSE" ,Ud WRKSHEET.BAS - COMP ED SUPPLIES WORK SHEETS PREPARED ACCORDING TO STYLE SHEETan63000xA$(6),X$(6),PAR$(20): STORE ANSWERS, X MARKS WRONG ANSWERS(4)"OPEN TITLE.TXT":(4)"READ TITLE.TXT":TI$:(4)"CLOSE" 59200:420: PUT"1-800-347-4242"* (4)"RUN WRKSHEET"V 24:7:"PRESS ANY KEY TO CONTINUE...";d 16368,0 K(16384):K1285030 dm. Copying, selling, or"I Y"otherwise distributing this program is"c ^"prohibited by law."| h8:1:S$:10:1:S$ m8:10:"COMP ED COPYRIGHT 1990" r16:17:"COMP ED":16:14:"P.O. BOX 35461" w18:10:"PHOENIX, ARIZONA 85069":19:14:th for answer$HILM1(L$(1))@R(L$(1),I,1)UL$LL1F\]f8000: get answerp(A$,1)" "A$(A$,(A$)1):880z(A$,1)" "A$(A$,(A$)1):890A$(Q)A$:A$RA$İ6000:NCNC1:970 ********** WRONG ANSWER **********:AY:40:"X":!I1NL(Q)3X1(L$(I))(L$(I),X,(RA$))RA$ĢAYI1:X:RA$;::I4: FORMERLY DID INVERSE BEFORE PRINT, BUT LOWER CASE NOT RIGHTX$(Q)"X"Q398059200:I1NLI:1:PAR$(I); vx'***************************************('Lawful users of this program are hereby$%licensed to read data from its medium$%for the express purposes of executing$"the program. Copying, selling, or$&otherwise distributing this program is$prohibi=(BLOAD TITLE.PIC,A$2000$lWlPl?lSJ||L|6ol6|6 CHR$ (127) THEN GOSUB 59100: GOTO 8015DCTMLİ59100:8015gCV:X:IC$;:CTCT1:A$A$IC$q8015CT0İ59100CT0CTCT1:XCHCT:CV:X:(95):A$(A$,1,(A$)1)8015CT0İ59100:8010x ********** TIM VERTICAL AND HORIZONTAL POSITIONS2O16368,0>TXCHCTN^CV:X:IC$\hIC(IC$)krIC27420|IC13CT0ı: DONEIC88120 IF IC$ > = "a" AND IC$ < = "z" THEN IC$ = CHR$ (IC - 32), IF IC$ < " " OR IC$  IF G = 0 THEN POKE 940,50600 / 200: POKE 941,21 * 6: CALL 942I@ ********** INPUT ROUTINE FOR LIMITED WORD LENGTH **********A(4): SO CAN USE GET$JMLL:A$"":CT0:CVAY:CHLM: MAXIMUM LENGTH, COUNT OF CHARACTERS ENTERED, CURSORAll done, "NA$"!":LM(20(P$)2)1:8:12:LM:P$_:14:12:"Your score was "NC;"."<16:10:"Are you ready for more?"B59200L420p ********** SOUND EFFECTS **********zREP13:940,50600(300REP150):941,212:942:CDAT":(4)"WRITE NS.DAT":NSNS1:NS:(4)"CLOSE": NUMBER OF STUDENT WORK SHEETS STORED ON DISK(4)"CLOSE":(4)"OPEN STUDENTS.DAT":(4)"APPEND STUDENTS.DAT"NA$:B$:NC:I16:NL(I):A$(I):X$(I):$(4)"CLOSE".SEC1:59000(3P$"Y(37)2Q:24:10:"ONE MOMENT, PLEASE...";c ********** store scores **********sNS0:1020(4)"CLOSE":(4)"OPEN NS.DAT":(4)"READ NS.DAT":NS:(4)"CLOSE":103063000: ##### RESUME 1030c(4)"CLOSE":(4)"OPEN NS.ted by law.$fd$f d$fd COMP ED COPYRIGHT 1990$fdCOMP ED$fdP.O. BOX 35461$fd PHOENIX, ARIZONA 85069$fd1-800-347-4242$ RUN WRKSHEET$fdPRESS ANY KEY TO CONTINUE...l|J 17348192lE,ln0$ 4   lfd4BJj J {J J  # CJ # Cfd4 Ҟ  CJ # J fd_$4 ž $CLOSE$CLOSE$OPEN STUDENTS.DAT$APPEND STUDENTS.DAT$ $$$$$$0CLOSE$  4Қ All done, ! ̪(f d $fd Your score was .$fd Are you ready for more?$ ? f d*00XJ 0 O ? (fd0|%2fd ONE MOMENT, PLEASE...6CLOSE$ OPEN NS.DAT$ READ NS.DAT$?LCLOSE$ 6 CLOSE$ OPEN NS.DAT$ WRITE NS.DAT$J |%0 4_JG 0  Jp 0 *J   4  tJ   4   J   $,f d(X$*J4ҚWS0$OPEN $READ $?4NJ END PARAGRAPHd }fd @0|%fREAD $?NJANSWER=4 fd$fd20) Page Twenty$fd 21) See directions$fd 22) Quit$fdWhat is your choice 4NJ22(f dBYE!$  J21 eJΞΞ$ H(fd"What is your name? _______________$    *4 CLOSE$() Page Five$f d15) Page Fifteen$f d 6) Page Six$f d16) Page Sixteen$f d 7) Page Seven$f d17) Page Seventeen$f d 8) Page Eight$f d18) Page Eighteen$f d 9) Page Nine$f d19) Page Nineteen$fd 10) Page Tenz|}~CLOSE$(fd$fd MENU SELECTION$fd 1) Page One$fd11) Page Eleven$fd 2) Page Two$fd12) Page Twelve$fd 3) Page Three$fd13) Page Thirteen$fd 4) Page Four$fd14) Page Fourteen$f d 5Y#b d 6 OPEN TITLE.TXT$READ TITLE.TXT$?4NCLOSE$ ? 4 WRKSHEET.DIRCLOSE$(OPEN$READ WRKSHEET.DIR$6?4Nfd$J ? ( J ? CLOSE$6 leverything in the universe is so far away that astronomers have to use the light years as a unit of measure. The star that is closest to the sun is four light years away. The nearest galaxy to ours is 170,000 light years away. --------------------------- LIGHT YEARS The distance that light travels in one year is called a light year. Light travels 300,000 miles (186,000 kilo- meters) every second. In one year light travels 9,460,000,000,000 miles or (5,878,000,000,000 kilometers). Most 136208520617332409202208245174172376174396@@  CJ # / 0lE lnfdPRESS ANY KEY TO CONTINUE...l!|J!| j 4"!J" J|ޔ  ('SORRY, THERE'S NOT ENOUGH ROOM TO STORE$$'YOUR RECORD. PLEASE TELL YOUR TEACHER.$ O &(!Plea7d REPORTS.BAS - PRINT REPORTS FROM STUDENTS.DATCn63000}xA$(6),X$(6): STORE ANSWERS, X MARKS WRONG ANSWERS:(4)"CLOSE":(4)"OPEN TITLE.TXT":(4)"READ TITLE.TXT":TI$:(4)"CLOSE" LM$" ": LEFT MARGIN FOR WO ",15)*MB$(" "B$,3)PNPC$(" "((100NC6)),3)"%"~RLM$;NA$;:" ";:B$;:" ";:PC$:LCLC1\I118:L$:: ACTUAL STUDENT ANSWERSfLC56ĺ(12):2060p2110z(12):420  ********** delete all records * FOUND!":59200:420"4000::2170: ASSUME EOFJ I13:::vLM$;:"Summary Sheet for "TI$" disk": LM$;"STUDENT NAME WS# SCORE"*LM$;"=============== === =====":LC8>(4)"READ STUDENTS.DAT":NA$:B$:NCHNA$(NA$" of student work **********'2040k(4)"CLOSE":(4)"OPEN STUDENTS.DAT":(4)"READ STUDENTS.DAT":JUNK$: TEST IF EMPTY(4)"CLOSE STUDENTS.DAT":(4)"OPEN STUDENTS.DAT":(4)"READ STUDENTS.DAT"2050:12:8:"NO STUDENT RECORDSL$(1)(L$(1),P1)A$(L$(1),(L$(1))P(A$)1)LLM$;L$(1);" ";X$;lX$"X"ĺ" ";L$(NL1):1280rL2NL:LM$;L$(L):: Q(12)(4)"CLOSE"F$1100((4)"CLOSE"*63000,420 ********** print summary :"Score: ";(100NC6);:"%":P(4)"READ"F$:L$:L$"END PARAGRAPH"1190bLM$;L$:1170qI12::|Q16(4)"READ STUDENTS.DAT":NL:A$:X$(4)"READ"F$:I1NL1:L$(I):I1(L$(1)):(L$(1),I,1)(95)PI:I405DS FOUND!":59200:420"B4000(CAG1320: ASSUME EOFkL(4)"READ STUDENTS.DAT":NA$:B$:NCVF$"WS"B$:(4)"OPEN"F$:(4)"READ"F$: FILE 2`I13::jLM$;:"Name: ";NA$:tLM$;"Disk: ";TI$~LM$;"Worksheet: ";B$!LM$; NS.DAT":NS:(4)"CLOSE"m:"This report will take "NS" pages.":"Do you wish to continue? (Y/N) ";YN$YN$"N"YN$"n"420$(4)"CLOSE":(4)"OPEN STUDENTS.DAT":(4)"READ STUDENTS.DAT": FILE 1.10908:12:8:"NO STUDENT RECORets" 12:1:"5) Quit"B &14:1:"What is your choice ";B$c 0B$"5"ė:12:19:"BYE!"::| N(B$)1(B$)4420 X(B$)1000,2000,3000,7000  ********** print worksheets ********** 1080(4)"CLOSE":(4)"OPEN NS.DAT":(4)"READ :1:20(TI$)2:TI$:3:13:"MENU SELECTION"U 5:11:"For teachers only!" 8:1:"1) Print all student work sheets" 9:1:"2) Print summary of student work" 10:1:"3) Delete all student records" 11:1:"4) Print blank work she*****". 612:10:"COMP ED COPYRIGHT 1990" @16:17:"COMP ED":17:14:"P.O. BOX 35461":18:10:"PHOENIX, ARIZONA 85069":19:14:"1-800-347-4242" J59200  ********** MENU ********** (4)"CLOSE":63000 (4)"PR#0" 16368,04ts medium":"for the express purposes of executing":"the program. Copying, selling, or":"otherwise distributing this product is" ""prohibited by law." ,8:1:"****************************************":10:1:"***********************************RKSHEET PRINTOUTS WS$(20):I120:WS$(I):: 1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20: FOR EASE OF NAMING FILES  ********** PUBLISHER'S PAGE ********** :"Lawful users of this program are hereby":"licensed to read data from i*********K :1:1:"Delete all records:":"Please confirm (Y/N) ";YN$e YN$"N"YN$"n"3060 (4)"OPEN NS.DAT":(4)"CLOSE":(4)"DELETE NS.DAT" (4)"OPEN STUDENTS.DAT":(4)"CLOSE":(4)"DELETE STUDENTS.DAT" :"RECORDS DELETED!":59200  420: ********** PRINTER READY? **********:"TURN YOUR PRINTER ON AND ADJUST THE":"PAPER TO THE TOP OF FORM."59200:(4)"PR#1"X ********** print blank worksheets ********** b:1:20(TI$)2:TI$:3:15:"PRIAT$?LCLOSE$(This report will take  pages.$Do you wish to continue? (Y/N) 4NJNny X(CLOSE$OPEN STUDENTS.DAT$READ STUDENTS.DAT$ (f dNO STUDENT RECORDS FOUND!$ X (6READ STUDENTary of student work$f d3) Delete all student records$f d4) Print blank work sheets$f d5) Quit$fdWhat is your choice 4NJ5(f dBYE!$JΞΞ XΞ 6CLOSE$ OPEN NS.DAT$ READ NS.DP ED$fdP.O. BOX 35461$fd PHOENIX, ARIZONA 85069$fd1-800-347-4242$ CLOSE$6%PR#0$l(fd$fd MENU SELECTION$fd For teachers only!$fd 1) Print all student work sheets$f d 2) Print summexecuting$"the program. Copying, selling, or$&otherwise distributing this product is$prohibited by law.$fd(****************************************$f d(****************************************$f d COMP ED COPYRIGHT 1990$fdCOMQ6%&(CLOSE$OPEN TITLE.TXT$READ TITLE.TXT$?4NCLOSE$4 >0('Lawful users of this program are hereby$%licensed to read data from its medium$%for the express purposes of :K12859230'hK155420: ESCAPE-rE UNEXPECTED ERROR"::"Please report problem to COMP ED:"::"Error # "(222)"occurred at line #"(218)(219)256,:59200: L$,7)"ANSWER="ĺ::7390'LM$;L$173208QC(12)dB$"21"WS20WSWS1:7190m420 CV:CHCT:"_":CV:CHCT:@ ********** PRESS ANY KEY **********J24:7:"PRESS ANY KEY TO CONTINUE...";T16368,0^K(16384)WS$(WS)7*(4)"CLOSE":(4)"OPEN"F$:(4)"READ"F$F4I13::Z>LM$;:"Name: "pHLM$;"Disk: ";TI$RLM$;"Worksheet: ";WS$(WS)\LM$;:"Score:"afL$:L$"END PARAGRAPH"7290pLM$;L$:7270zI12::Q16L$:() Page Ten":14:21:"20) Page Twenty"K16:12:"21) Print all pages"r17:12:"22) Return to main menu"19:1:"What is your choice ";B$B$"22"420(B$)1(B$)21ĺ(7):7140 4000 WS(B$):B$"21"WS1 F$"ws") Page Fifteen"G10:2:"6) Page Six":10:21:"16) Page Sixteen"11:2:"7) Page Seven":11:21:"17) Page Seventeen"12:2:"8) Page Eight":12:21:"18) Page Eighteen"13:2:"9) Page Nine":13:21:"19) Page Nineteen"(14:1:"10NT MENU"<l5:2:"1) Page One":5:21:"11) Page Elevenov6:2:"2) Page Two":6:21:"12) Page Twelve"7:2:"3) Page Three":7:21:"13) Page Thirteen"8:2:"4) Page Four":8:21:"14) Page Fourteen"9:2:"5) Page Five":9:21:"15S.DAT$?4 N?4N? L4 ҚWSOPEN $READ $$0Name:  $Disk: $ Worksheet: $Score: ̮d %$$READ $?4 NJ END PARAGRAPH  $ $0 READ STUDENTS.DAT$?L?4N?4NREAD $?N0J_Z(0Ҽ JX $ $$0$2  $CLOSE $ CLOSE$6% X6CLOSE$ VACCINE The white blood cells in your body produce antibodies to destroy disease germs. The antibodies stay in your body and fight off the same germs if they enter your body again. Sometimes when disease germs enter your body, your bse report problem to COMP ED:$$Error #|occurred at line #|ڬ|ۖ$$CLOSE$ ? @@@@@@@@@@@ '/ <=K >?tBCNO ,` L蘅`l|J J$ X&(!Please report problem to COMP ED:$$Error # |occurred at line #|ڬ|ۖ$` 1234567891011121314151617181920@@@@@@@@@@@me: $Disk: $ Worksheet: $Score:$$?4 NJ END PARAGRAPHZ d  $ : $0 ?4 NJ ANSWER= $$  $ t 2  $J21  Xfd_$fdfdPRESS ANY KEY TO CONTINUE...n$fd20) Page Twenty$fd 21) Print all pages$fd 22) Return to main menu$fdWhat is your choice 4NJ22 XJΞΞ $ Y (ΞJ21 4 ҚwsCLOSE$OPEN $READ $$0Na5) Page Five$f d15) Page Fifteen$f d 6) Page Six$f d16) Page Sixteen$f d 7) Page Seven$f d17) Page Seventeen$f d 8) Page Eight$f d18) Page Eighteen$f d 9) Page Nine$f d19) Page Nineteen$fd 10) Page Te$ $PR#1$(fd$fd PRINT MENU$fd 1) Page One$fd11) Page Eleven$fd 2) Page Two$fd12) Page Twelve$fd 3) Page Three$fd13) Page Thirteen$fd 4) Page Four$fd14) Page Fourteen$f d ease confirm (Y/N) 4NJNn+  OPEN NS.DAT$CLOSE$ DELETE NS.DAT$OPEN STUDENTS.DAT$CLOSE$DELETE STUDENTS.DAT$$RECORDS DELETED!$ X(#TURN YOUR PRINTER ON AND ADJUST THE$PAPER TO THE TOP OF FORM.E$=============== === =====$READ STUDENTS.DAT$?4 N?4N? L4 Ҟ  4Қ 4ҾҚ ̮d %   $?4 N0J8 $  ' $ X(fdDelete all records:$PlOPEN STUDENTS.DAT$READ STUDENTS.DAT$?4NCLOSE STUDENTS.DAT$OPEN STUDENTS.DAT$READ STUDENTS.DAT$ (f dNO STUDENT RECORDS FOUND!$ X (6$0Summary Sheet for  disk$$STUDENT NAME WS# SCORody is not strong enough to fight them. Most vaccines have disease germs that have been killed or weakened. When you receive a vaccine your body makes antibodies against the disease, then your body can fight the disease. --------------------------------- VENUS Venus is the second planet from the sun. It takes Venus 225 Earth days to orbit the sun. It takes the Earth about 365 days to orbit the sun. That is one year. It takes Venus 243 Earth days to rotate on its axis. It takes theu are given a 6. _______ vaccine for measles you will probably get very sick. yes no ANSWER=no =four 4. Malaria is caused by 4. _____ a sarcodine. yes no ANSWER=no 5. African sleeping 5. _____ sickness is cause by a sporozoan. true false ANSWER=false 6. Protozoans are alive. 6. _____ true false ANSWER=truerect answer on the line. END PARAGRAPH 1. How many cells do pro- 1. _____ zoans have? ANSWER=one 2. Protozoans feed on 2. _____ other living things. true false ANSWER=true 3. How many groups of 3. _____ protozoans are there? ANSWER sporozoans do not move in a special way. They can cause malaria. The ciliates have small threads sticking out all around the cell. They help it to move. The sarcodines move by changing their shapes. --------------------------------------- Type the cor PROTOZOANS Protozoans are one-celled living things. They feed on other living things. There are four groups of pro- tozoans. The flagellates have a long thread at one end of the cell. One kind can cause African sleeping sickness. The 3. _______ produce antibodies. ANSWER=white 4. Antibodies leave your 4. _______ body after you are cured. true false ANSWER=false 5. A vaccine causes your 5. _______ body to produce antibodies. true false ANSWER=true 6. If yo------ Type the correct answer on the line. END PARAGRAPH 1. Antibodies ( ) disease 1. _______ germs. ANSWER=destroy 2. A polio vaccine actualy 2. _______ puts a killed or weakend polio germ into your body. yes no ANSWER=yes 3. The ( ) blood cell Earth 24 hours to rotate on its axis. That is one day. Most planets rotate in the same direction that they are orbiting the sun. Venus and Uranus rotate in the opposite direction. There is no sign of water on Venus. ----------------------------------- SOLAR ENERGY Energy from the sun is called solar energy. Hydrogen atoms in the sun unite to form helium every second. This causes energy to be released. Most of the energy travels into space. Earth receives a very small amount of the suncopes 6. _____ are large, therefore they must be refracting telescopes. yes no ANSWER=no can collect radio waves. yes no ANSWER=no 4. Radio telescopes use 4. _____ light to collect radio waves. true false ANSWER=false 5. Curved mirrors bend the 5. _____ light. true false ANSWER=false 6. Astonomers teles--------------- Type the correct answer on the line. END PARAGRAPH 1. A telescope makes things 1. _____ bigger. true false ANSWER=false 2. A telescope magnifys the 2. _____ ( ) of an object. ANSWER=image 3. An optical telescope 3. _____ e called refracting telescopes. Large telescopes are reflecting telescopes. They have curved mirrors that reflect and focus the light. The larger the mirror is the more light it can collect. More can be seen with a bigger mirror. ------------------------ TELESCOPES A telescope magnifies the image of a distant object. An optical tele- scope takes in light. Radio telescopes take in radio waves. Telescopes have lenses and mirrors. The lenses in small telescopes bend the light. These arh ANSWER=Venus 6. Are there signs of 6. ______ life on Venus? yes no ANSWER=no n its 3. ______ axis in the same direction as does the Earth. yes no ANSWER=no 4. Venus is the ( ) 4. ______ planet from the sun. ANSWER=second 5. Earth is the third 5. ______ planet from the sun. Which is closest to the sun? Venus Eart---- Type the correct answer on the line. END PARAGRAPH 1. A year for Venus would 1. ______ be 225 days. true false ANSWER=true 2. One day for Venus 2. ______ would be 243 Earth days. true false. ANSWER=true 3. Venus rotates o's energy. Solar energy is un- limited. It does not cause pollution. Solar energy can be collected and stored. Semiconductors can turn solar energy into electricity. This can be stored in batteries. --------------------------------------- Type the corrn is made up of helium and hydrogen gases. The core is the center of the sun. Hydrogen and helium surround the core. The next layer is the photo- sphere. Above this is the chromosphere, and above this is the corona. ----------------------------------- THE SUN The sun is one of the billions of stars. It is about average in bright- ness and in size. It is more than 109 times bigger than the Earth. The gravi- tational pull of the sun holds the planets in their orbits. Most of the su in a gas. yes no ANSWER=yes 4. A gas takes a definate 4. _____ shape. true false ANSWER=false 5. The molecules in a 5. _____ ( ) move only slightly. ANSWER=solid 6. The molecules in a ( ) 6. _____ move freely. ANSWER=gas END PARAGRAPH 1. Matter exists as a gas, 1. _____ ( ), or a liquid. ANSWER=solid 2. The molecules in a gas 2. _____ move more than those in a solid. true false ANSWER=true 3. The molecules in a 3. _____ liquid are closer together than thosen a liquid are farther apart and they move more than in a solid. This is why liquids flow. The molecules in gases are far- ther apart than those in liquids and they move freely. --------------------------------------- Type the correct answer on the line. SOLIDS, LIQUIDS, GASES Matter exists as a liquid, solid, or a gas. Matter is made up of mole- cules. The molecules are close togeth- er in a solid, and they move slightly. Because of this, solids can form defi- nate shapes. The molecules ittery could use solar energy. yes no ANSWER=yes false ANSWER=true 4. Someday we will run out 4. _____ of the sun's energy. yes no ANSWER=no 5. Once solar energy is 5. _____ collected it must be used right away. true false ANSWER=false 6. An electric car with a 6. _____ baect answer on the line. END PARAGRAPH 1. Solar energy is manmade. 1. _____ true false ANSWER=false 2. Hydrogen ( ) unite to 2. _____ form helium. ANSWER=atoms 3. Earth receives a small 3. _____ amount of the sun's energy. true ---- Type the correct answer on the line. END PARAGRAPH 1. The sun is much larger 1. ______ than the other stars. true false ANSWER=false 2. There is gravity on 2. ______ the sun. true false ANSWER=true 3. The Earth is largeatmosphere it changes into drops of water which form into clouds. The water drops fall from the clouds in the form of rain if they do not freeze on their way to the earth. --------------------------------------- Type the correct answer on the line. END P RAIN Drops of water that fall from the clouds are called rain. Water from bodies of water on the Earth is con- stantly evaporating. When the water evaporates it rises into the air. When the water gets into the cooler levels of the and distance. ANSWER=shape 6. Sonar can find things 6. ______ in the ( ). ANSWER=water cho 3. A radar screen is used 3. ______ to find things in the water. true false ANSWER=false 4. Sonar uses radio waves 4. ______ to tell about objects. true false ANSWER=false 5. Radar can tell about an 5. ______ objects size, ( )--------- Type the correct answer on the line. END PARAGRAPH 1. When sound waves and 1. ______ radio waves hit a solid object they ( ) back. ANSWER=bounce 2. A sound wave that 2. ______ bounces back that you can hear is called an ( ). ANSWER=e about the size and shape of the object the radio wave hits. It can also tell how far away the object is. Sonar uses sound waves to find things under water. The sonar screen can tell about an objects size, shape, distance. ------------------------------ RADAR AND SONAR When you hear an echo you are hearing a sound wave that has bounced off a solid object. When a sound wave hits a solid object it bounces back. When radio waves hit something solid they bounce back. A radar screen can telly of helium and hydrogen gases. true false ANSWER=true r 3. ______ than the sun. yes no ANSWER=no 4. The planets need the 4. ______ sun to keep them in their ( ). ANSWER=orbits 5. The outer layer of the 5. ______ sun is the ( ). ANSWER=corona 6. The sun is made up of 6. ______ mostlARAGRAPH 1. Some of the water that 1. ______ falls as rain comes from bodies of water on the Earth. yes no ANSWER=yes 2. When water evaporates it 2. ______ ( ) into the air. ANSWER=rises 3. The water vapor in the 3. ______ air can change back to------- Type the correct answer on the line. END PARAGRAPH 1. Vertebrates are 1. _________ animals with ( ). ANSWER=backbones 2. Reptiles have lungs 2. _________ so they can breathe in water. true false ANSWER=false 3. All reptiles have ort legs. Snakes are reptiles without legs. Most reptiles are carnivores, meaning they eat meat. They are cold-blooded animals. This means that their body temperature changes with as the temper- ture around them changes. -------------------------------- REPTILES Reptiles are vertebrates. This means that they are animals with back- bones. Their bodies are covered with a dry, scaly skin. Reptiles have lungs and breathe air. The word reptile means to crawl. Most reptiles have four sh. true false ANSWER=true 5. Can redwood trees 5. ________ survive after a forest fire? (yes/no) ANSWER=yes 6. Redwood trees grow in 6. ________ Maine. true false ANSWER=false ________ survive after a forest fire? (yes/no) ANSWER=yes 6.________ a redwood or an apple? ANSWER=redwood 2. Do you find redwoods 2. ________ in Oregon, Arizona, or Iowa? ANSWER=Oregon 3. Sempervirens means 3. ________ short-lived true false ANSWER=false 4. Sequoia trees need 4. ________ moisturepervirens means "always living." Redwood trees do not really live forever, but their bark is very resistant to fire and insect damage. --------------------------------------- Type the correct answer on the line. END PARAGRAPH 1. Which tree is taller, 1. REDWOOD TREES Redwood trees grow along the Pacific coast where the weather is moist and foggy. They are the tallest living tree in the world. They can grow over 300 feet tall! The scientific name for redwoods is "Sequoia sempervirens." Sem__ on their way to the earth they are called rain. yes no ANSWER=no a liquid. true false ANSWER=true 4. As the water vapor gets 4. ______ cooler it changes to drops of water. true false ANSWER=true 5. Clouds are made from 5. ______ drops of ( ) and dust. ANSWER=water 6. If water drops freeze 6. ____ 3. _________ legs. yes no ANSWER=no 4. Carnivore means to 4. _________ eat ( ). ANSWER=meat 5. Reptiles are ( )- 5. _________ blooded. ANSWER=cold 6. The body temperature 6. _________ of a reptile always stays the same. true false ANSWER=false ----------------- Type the correct answer on the line. END PARAGRAPH 1. There are ( ) main 1. ________ of rocks. ANSWER=three 2. Sedimentary rocks are 2. ________ formed from metamorphic rocks. true false ANSWER=false 3. What kind of rockormed deep in the earth. As melted rock material rises to the earth's sur- face it cools and hardens. Metamorphic rocks are made when sedimentary rocks are buried, and the earth's pressure and heat change them to metamorphic rocks. ---------------------- ROCKS There are three main kinds of rocks. Sedimentary rocks are formed on the surface or near the surface of the earth. They form as layers of sediments like mud, sand, silt, and clay pile on top of each other. Igneous rocks are fduring the night? ANSWER=oxygen dioxide. ANSWER=carbon 4. Sometimes animals 4. ______ breathe out oxygen. true false ANSWER=false 5. Do small one-celled 5. ______ living things carry on respiration? yes no ANSWER=yes 6. What do plants take in 6. ______ ----- Type the correct answer on the line. END PARAGRAPH 1. The process of breathing 1. ______ is called respiration. true false ANSWER=true 2. Animals breathe ( ) in. 2. ______ ANSWER=oxygen 3. Animals breathe out 3. ______ ( )on dioxide. The lungs breathe out this carbon dioxide. Fish get their oxygen from water through their gills. Plants take in carbon dioxide during the day and give off oxygen. They do just the opposite during the night. ---------------------------------- RESPIRATION Animals breathe in and out. This is called respiration. All living things carry out respiration. Animals with lungs breathe oxygen in. The body uses the oxygen when it makes energy. When the body makes energy it makes carb is 3. ________ formed from melted rock? ANSWER=igneous 4. Is igneous rock in a 4. ________ liquid form like lava? yes no ANSWER=no 5. Is metamorphic rock 5. ________ made from another kind of rock? yes no ANSWER=yes 6. Sedimentary rocks are 6. ________ formed near the ( ) of the earth. ANSWER=surface answer on the line. END PARAGRAPH 1. You do not use any 1. ________ muscles when you lie in bed. true false ANSWER=false 2. Your ( ) send 2. ________ messages to your muscles. ANSWER=nerves 3. What do muscle cells 3. ________ buntract when you lift a heavy object. Muscles burn glucose and use oxygen for energy. The bloodstream supplies these to the muscles. There are three kinds of muscles: skeletal, cardiac, and smooth. --------------------------------------- Type the correct MUSCLES Your muscles make all your move- ments possible. Your muscles receive messages from your nerves. These tell your muscles exactly what to do. Muscle is a tough, elastic tissue. It is made of flat, long cells. Muscle cells co false ANSWER=false each atom. ANSWER=nucleus 4. The nucleus of an atom 4. _______ is held together by tremen- dous ( ). ANSWER=forces 5. Nuclear ( ) is the 5. _______ splitting of the atom. ANSWER=fission 6. Nuclear energy is very 6. _______ safe. true ---------------------- Type the correct answer on the line. END PARAGRAPH 1. Nuclear power is one 1. _______ kind of ( ). ANSWER=energy 2. Nuclear power comes 2. _______ from splitting ( ). ANSWER=atoms 3. A ( ) is in the middle 3. _______ of ts have learned how to split the nuclei of some atoms. This releases huge amounts of energy. The splitting of the atom is called nuclear fission. Materials from nuclear reaction are radioactive. They are harmful and must be contained. ----------------- NUCLEAR POWER Nuclear power is one kind of energy that is used to make electri- city. Nuclear power comes from break- ing or splitting atoms. A nucleus is in the middle of each atom. It is held to- gether by tremendous forces. Scientisrn? ANSWER=glucose 4. The bloodstream 4. ________ supplies glucose and ( ) to the muscles. ANSWER=oxygen 5. Muscles ( ) when you 5. ________ lift something. ANSWER=contract 6. Muscle is a tough, 6. ________ ( ) tissue. ANSWER=elastic NERVES Nerves link the body organs and muscles to the spinal cord and to the brain. They are cordlike fibers. The nerves carry messages to and from the brain. These messages tell your body organs and muscles how to respond. If you wtimes smaller than the Earth. yes no ANSWER=yes 6. Which planet travels 6. _______ the fastest around the sun. ANSWER=Mercury 3. It takes longer for the 3. _______ Earth to travel around the sun than it does for Mercury. yes no ANSWER=yes 4. A day lasts longer on 4. _______ Mercury than on the Earth. true false ANSWER=true 5. Mercury is about two 5. _______ -------------------- Type the correct answer on the line. END PARAGRAPH 1. Mercury is larger than 1. ________ the Earth. true false ANSWER=false 2. Mercury is closer to 2. _______ the sun than the Earth is. true false ANSWER=true o travel around the sun. Mercury travels around the sun faster than any other planet. Earth is more than twice the size of Mercury. A day on the Earth lasts for 24 hours. A day on Mercury is about the same as 29 days on the Earth. -------------------- MERCURY Mercury is the closest planet to the sun. It is the second-smallest planet. Pluto is the smallest planet. It takes the Earth 365 days to travel around the sun. Since Mercury is closer to the sun it only takes 88 days for it the body. yes no ANSWER=yes ). ANSWER=brain 4. You could ride a bike 4. ______ if you did not have nerve cells. yes no ANSWER=no 5. Nerve cells only tell 5. ______ your muscles how to act. true false ANSWER=false 6. Electrical changes take 6. ______ place in t--------- Type the correct answer on the line. END PARAGRAPH 1. What links the body 1. ______ organs and muscles to the spinal cord. ANSWER=nerves 2. Nerves are cordlike 2. ______ ( ). ANSWER=fibers 3. Nerves carry messages 3. ______ to the ( ant to take a walk, your brain messages to various nerve cells, and the message to walk goes to the muscles that will make you walk. Chemical and elec- trical changes take place as a nerve impulse travels down a nerve cell. ------------------------------- Redwood trees grow in 6. ________ of water that branch off the Pacific. It is the world's deepest ocean. There are mountains, valleys, and volcanoes in the Pacific Ocean. It is the world's largest habitat for marine life. --------------------------------------- Type the correct answer o THE PACIFIC OCEAN The world's largest ocean is the Pacific Ocean. It extends from the cold Arctic to the warm tropics to the cold Antarctic. The Pacific Ocean covers about one third of the earth'surface. Gulfs and seas are smaller bodies about 170,000 miles away. true false ANSWER=false 6. The star closest to the 6. ______ sun is ( ) light years away. ANSWER=four ANSWER=no 3. A light year is the 3. ______ distance that light travels in ( ) year. ANSWER=one 4. It would be easier for 4. ______ astronomers to use the term miles instead of light years. yes no ANSWER=no 5. The nearest galaxy is 5. ______ ------------ Type the correct answer on the line. END PARAGRAPH 1. Does light travel 1. ______ at a slow rate of speed? yes no ANSWER=no 2. Astronomers use the 2. ______ term light year because light travels to the stars. yes noy no 3 false 3 yes 20 20 4 3 false 3 true X 3 yes 3 true 3 yes 2 Mercur X 2 2 6 3 no 3 no 3 one 3 no 3 false 2 four 17 17 6 3 yes 3 yes 3 true 2 third 3 false 3 marine false 3 yes 2 oxygen d 15 4 2 three 3 false 2 igneous 3 no 3 yes X 3 surfac X 16 16 4 2 energy 2 atoms 2 nucleu X 3 forces 2 fissio X 3 false 18 18 6 3 false 2 nerves 2 glucose 3 oxygen 2 contract 2 elastic 19 19 4 3 nerves 2 X 0 X 3ne 3 true 2 four 3 no 3 false 2 true 10 10 6 3 bounce 3 echo 3 false 3 false 2 shape 2 water 11 11 6 3 yes 2 rises 3 true 3 true 2 water 3 no 13 13 6 2 backbones 3 false 2 no 2 meat 2 cold 3 false 14 14 5 3 true 2 air X 2 carbon 3n the line. END PARAGRAPH 1. The Pacific Ocean 1. ______ extends from the top of the earth to the bottom. yes no ANSWER=yes 2. People in cold climates 2. ______ and people in warm climates live near the Pacific. yes no ANSWER=yes 3. The Atlaalse 6. There is a great 6. ______ amount of ( ) life in the Pacific Ocean. ANSWER=marine ntic Ocean is 3. ______ smaller than the Pacific. true false ANSWER=true 4. The Pacific covers 4. ______ about one ( ) of the earth. ANSWER=third 5. The land is all level 5. ______ in the Pacific ocean. true false ANSWER=f